|
|
| | 1-Boc-4-methylpiperidine Basic information |
| Product Name: | 1-Boc-4-methylpiperidine | | Synonyms: | 4-METHYL-PIPERIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER;4-Methylpiperidine-1-carboxylate tert-butyl;N-tert-Butyloxycarbonyl-4-Methyl-2-piperidine;1-Piperidinecarboxylic acid, 4-methyl-, 1,1-dimethylethyl ester;tert-butyl 4-methylpiperidine-1-carboxylate;1-Boc-4-Methylpiperidine, CAS 123387-50-8;1-Boc-4-methylpiperidine | | CAS: | 123387-50-8 | | MF: | C11H21NO2 | | MW: | 199.29 | | EINECS: | 604-604-1 | | Product Categories: | | | Mol File: | 123387-50-8.mol |  |
| | 1-Boc-4-methylpiperidine Chemical Properties |
| Boiling point | 255.0±9.0 °C(Predicted) | | density | 0.973±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Dichloromethane, Ether, Ethyl Acetate, Hexanes | | form | Oil | | pka | -1.24±0.40(Predicted) | | color | Yellow | | InChI | InChI=1S/C11H21NO2/c1-9-5-7-12(8-6-9)10(13)14-11(2,3)4/h9H,5-8H2,1-4H3 | | InChIKey | OXSSNJRGXRJNPX-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(C)CC1 |
| | 1-Boc-4-methylpiperidine Usage And Synthesis |
| Uses | 1,4-Disubstituted piperidine derivative, used in the preparation of thrombin inhibitors. |
| | 1-Boc-4-methylpiperidine Preparation Products And Raw materials |
|