H-Leu-AMC HCl manufacturers
|
| | H-Leu-AMC HCl Basic information |
| | H-Leu-AMC HCl Chemical Properties |
| Melting point | 248 °C | | storage temp. | -20°C | | solubility | DMF: 25 mg/ml,DMSO: 25 mg/ml,DMSO:PBS (pH 7.2) (1:3): 0.25 mg/ml | | form | Powder | | color | White to almost white | | InChI | InChI=1/C16H20N2O3.ClH/c1-9(2)6-13(17)16(20)18-11-4-5-12-10(3)7-15(19)21-14(12)8-11;/h4-5,7-9,13H,6,17H2,1-3H3,(H,18,20);1H/t13-;/s3 | | InChIKey | VCRXITKKWBOQRZ-PHCOUKOGNA-N | | SMILES | CC1=CC(=O)OC2=CC(NC(=O)[C@@H](N)CC(C)C)=CC=C12.Cl |&1:12,r| |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 3-8-10 | | HS Code | 29322090 | | Storage Class | 11 - Combustible Solids |
| | H-Leu-AMC HCl Usage And Synthesis |
| Chemical Properties | white to almost white powder | | Uses | Fluorogenic substrate for leucine aminopeptidase. Sensitivity of fluorescence detection is greatly increased over other methods such as 4-Methoxy-naphthylamide (pNA) assays. | | Uses | Sensitive, fluorogenic substrate for aminopeptidases, e.g. aminopeptidase M. | | Uses | L-Leucin-7-amido-4-methylcoumarin-hydrochlorid is a leucine aminopeptidase fluoregenic substrate. | | General Description | L-Leucine-7-amido-4-methylcoumarin hydrochloride (Leu-AMC) is a fluorogenic peptidyl substrate, used for aminopeptidase activity. |
| | H-Leu-AMC HCl Preparation Products And Raw materials |
|