- Leu-Ala-OH
-
-
2026-07-03
- CAS:7298-84-2
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | L-LEUCYL-L-ALANINE Basic information |
| | L-LEUCYL-L-ALANINE Chemical Properties |
| Melting point | 255-256 °C (decomp) | | Boiling point | 409.7±30.0 °C(Predicted) | | density | 1.108±0.06 g/cm3(Predicted) | | refractive index | 19 ° (C=5, MeOH) | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Water:100.0(Max Conc. mg/mL);494.43(Max Conc. mM) | | form | Solid | | pka | 3.16±0.10(Predicted) | | color | White to off-white | | BRN | 1726165 | | InChI | InChI=1S/C9H18N2O3/c1-5(2)4-7(10)8(12)11-6(3)9(13)14/h5-7H,4,10H2,1-3H3,(H,11,12)(H,13,14)/t6-,7-/m0/s1 | | InChIKey | HSQGMTRYSIHDAC-BQBZGAKWSA-N | | SMILES | C(O)(=O)[C@H](C)NC(=O)[C@H](CC(C)C)N | | CAS DataBase Reference | 7298-84-2(CAS DataBase Reference) | | EPA Substance Registry System | L-Alanine, L-leucyl- (7298-84-2) |
| WGK Germany | 3 | | F | 3-10 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids |
| | L-LEUCYL-L-ALANINE Usage And Synthesis |
| Chemical Properties | white powder | | Uses | ubiquitin blocker, neurite growth inhibitor | | Uses | This dipeptide inhibits ubiquitin-mediated protein degradation. | | Uses | (2S)-2-[[(2S)-2-Azaniumyl-4-methylpentanoyl]amino]propanoate is used in muscle synthesis promoting agent comprising whey protein Hydrolyzate. | | Definition | ChEBI: A dipeptide composed of L-leucine and L-alanine joined by a peptide linkage. |
| | L-LEUCYL-L-ALANINE Preparation Products And Raw materials |
|