| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | GALLIUM(III) 2,4-PENTANEDIONATE Basic information |
| Product Name: | GALLIUM(III) 2,4-PENTANEDIONATE | | Synonyms: | Gallium,tris[2,4-pentanedionato-O,O’]-(OC-6-11)-;Galliumtrisacetylacetone;GALLIUM(III) 2,4-PENTANEDIONATE;GALLIUM(III) ACETYLACETONATE;GALLIUM ACETYL ACETONATE;Gallium(III) acetylacetonate (99.99+% Ga) PURATREM white powder;tris(pentane-2,4-dionato-O,O')gallium;Tris-(2,4-pentanedionato)-gallium | | CAS: | 14405-43-7 | | MF: | C15H21GaO6 | | MW: | 367.05 | | EINECS: | 238-377-0 | | Product Categories: | metal beta-diketonate complexes | | Mol File: | 14405-43-7.mol |  |
| | GALLIUM(III) 2,4-PENTANEDIONATE Chemical Properties |
| Melting point | 196-198 °C (dec.)(lit.) | | Boiling point | 140°C 10mm | | density | 1,42 g/cm3 | | storage temp. | Inert atmosphere,Room Temperature | | form | Powder | | Specific Gravity | 1.42 | | color | white to pale yellow | | Water Solubility | Insoluble in water. | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/3C5H8O2.Ga/c3*1-4(6)3-5(2)7;/h3*3,6H,1-2H3;/q;;;+3/p-3/b3*4-3-; | | InChIKey | ZVYYAYJIGYODSD-LNTINUHCSA-K | | SMILES | [Ga](O/C(/C)=C\C(=O)C)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-36/37/38-40 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | TSCA | No | | HS Code | 2914199090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | GALLIUM(III) 2,4-PENTANEDIONATE Usage And Synthesis |
| Chemical Properties | monoclinic white powder(s) [STR93] [CRC10] | | Uses | It is used in research on Ga-containing materials. Gallium oxide thin films can be created with atomic layer epitaxy (ALE) by combining gallium acetylacetonate with either water or ozone as the precursor. It can also be used for the synthesis of high purity gallium nitride nano-wires and nano-needles at low temperatures. | | General Description | Gallium acetylacetonate, is a coordination complex with three acetylacetone ligands, is used in research on Ga-containing materials. The molecule has D3 symmetry, being isomorphous with other octahedral tris(acetylacetonate)s | | reaction suitability | core: gallium
reagent type: catalyst |
| | GALLIUM(III) 2,4-PENTANEDIONATE Preparation Products And Raw materials |
|