| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | Methyl 3,4-O-isopropylidene-L-threonate Basic information |
| Product Name: | Methyl 3,4-O-isopropylidene-L-threonate | | Synonyms: | (ALPHAR,4S)-2,2-DIMETHYL-ALPHA-HYDROXY-1,3-DIOXOLANE-4-ACETIC ACID METHYL ESTER;3,4-O-ISOPROPYLIDENE-L-THREONIC ACID METHYL ESTER;(αr,4s)-2,2-dimethyl-α-hydroxy-1,3-dioxolane-4-acetic acid methyl ester;(αR,4S)-2,2-Dimethyl-α-hydroxy-1,3-dioxolane-4-acetic acid methyl ester, 3,4-O-Isopropylidene-L-threonic acid methyl ester;(R)-Methyl 2-((S)-2,2-diMethyl-1,3-dioxolan-4-yl)-2-hydroxyacetate;Methyl 3,4-O-isopropylidene-L-threonate 97%;1,3-Dioxolane-4-acetic acid, α-hydroxy-2,2-dimethyl-, methyl ester, (αR,4S)-;Methyl 3,4-O-isopropylidene-L-threonate | | CAS: | 92973-40-5 | | MF: | C8H14O5 | | MW: | 190.19 | | EINECS: | | | Product Categories: | | | Mol File: | 92973-40-5.mol |  |
| | Methyl 3,4-O-isopropylidene-L-threonate Chemical Properties |
| Boiling point | 125 °C12 mm Hg(lit.) | | density | 1.175 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.446(lit.) | | Fp | 210 °F | | pka | 12.03±0.20(Predicted) | | form | liquid | | Optical Rotation | [α]20/D +18.5°, c = 2 in acetone | | BRN | 7862 | | InChI | 1S/C8H14O5/c1-8(2)12-4-5(13-8)6(9)7(10)11-3/h5-6,9H,4H2,1-3H3/t5-,6+/m0/s1 | | InChIKey | JSFASCPVVJBLRD-NTSWFWBYSA-N | | SMILES | COC(=O)[C@H](O)[C@@H]1COC(C)(C)O1 |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids |
| | Methyl 3,4-O-isopropylidene-L-threonate Usage And Synthesis |
| Uses | Used to prepare a dihydrofuran substrate in the total synthesis of (-)-echinosporin. |
| | Methyl 3,4-O-isopropylidene-L-threonate Preparation Products And Raw materials |
|