TRANS-DECAHYDRONAPHTHALENE manufacturers
|
| | TRANS-DECAHYDRONAPHTHALENE Basic information |
| Product Name: | TRANS-DECAHYDRONAPHTHALENE | | Synonyms: | decahydronaphthalene(trans-);Decahydronaphthalene, trans-;t-Decalin;trans-Bicyclo[4.4.0]Decane;trans-Decaline;trans-naphthalen;TRANS-PERHYDRONAPHTHALENE;TRANS-NAPHTHALANE | | CAS: | 493-02-7 | | MF: | C10H18 | | MW: | 138.25 | | EINECS: | 207-771-4 | | Product Categories: | | | Mol File: | 493-02-7.mol |  |
| | TRANS-DECAHYDRONAPHTHALENE Chemical Properties |
| Melting point | −32 °C(lit.) | | Boiling point | 185 °C756 mm Hg(lit.) | | density | 0.87 g/mL at 25 °C(lit.) | | vapor density | 4.76 (vs air) | | vapor pressure | 42 mm Hg ( 92 °C) | | refractive index | n20/D 1.469(lit.) | | Fp | 127 °F | | storage temp. | Store below +30°C. | | Water Solubility | Insoluble in water | | form | clear liquid | | color | Colorless to Almost colorless | | explosive limit | 0.7-4.9%, 100°F | | Thermal Conductivity | 0.113 W/(m·K) at 25 ℃ | | Specific Heat Capacity | Cp(liquid): 1.65 J/(g·K), at 25℃ | | Merck | 14,2846 | | BRN | 2036251 | | Henry's Law Constant | 2.7×10-4 mol/(m3Pa) at 25℃, Mackay et al. (1993) | | Dielectric constant | 2.1(20℃) | | Stability: | Stable. Combustible. Incompatible with oxidizing agents. May form explosive peroxides in storage. | | InChI | 1S/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/t9-,10- | | InChIKey | NNBZCPXTIHJBJL-MGCOHNPYSA-N | | SMILES | [H][C@@]12CCCC[C@@]1([H])CCCC2 | | CAS DataBase Reference | 493-02-7(CAS DataBase Reference) | | EPA Substance Registry System | trans-Decahydronaphthalene (493-02-7) |
| Hazard Codes | C,N | | Risk Statements | 10-34-65-51/53-20 | | Safety Statements | 26-36/37/39-45-62-61 | | RIDADR | UN 1147 | | WGK Germany | 3 | | RTECS | QJ3150000 | | Autoignition Temperature | 482 °F | | TSCA | TSCA listed | | HS Code | 2902 19 00 | | HazardClass | 3 | | PackingGroup | III | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Inhalation
Aquatic Chronic 2
Asp. Tox. 1
Eye Dam. 1
Flam. Liq. 3
Skin Corr. 1C |
| | TRANS-DECAHYDRONAPHTHALENE Usage And Synthesis |
| Chemical Properties | liquid | | Uses | trans-Decahydronaphthalene has been used to measure absolute photoionization and dissociative photoionization cross-section for photon energies. | | Definition | ChEBI: The trans-stereoisomer of decalin. | | Purification Methods | See purification of cis-isomer above. [Seyer & Walker J Am Chem Soc 60 2125 1938, Baker & Schuetz J Am Chem Soc 69 1250 1949, Beilstein 5 IV 311.] |
| | TRANS-DECAHYDRONAPHTHALENE Preparation Products And Raw materials |
|