- 7-ACCA
-
-
2025-12-19
- CAS:53994-69-7
- Min. Order: 10mg
- Purity: 90%+
- Supply Ability: 10g
|
| | 7-Amino-3-chloro cephalosporanic acid Basic information |
| | 7-Amino-3-chloro cephalosporanic acid Chemical Properties |
| Melting point | >180°C (dec.) | | Boiling point | 498.9±45.0 °C(Predicted) | | density | 1.81±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | solubility | Aqueous Acid (Slightly, Heated), DMSO (Slightly, Heated, Sonicated) | | pka | 1.87±0.50(Predicted) | | form | Solid | | color | Pale Yellow | | InChI | InChI=1S/C7H7ClN2O3S/c8-2-1-14-6-3(9)5(11)10(6)4(2)7(12)13/h3,6H,1,9H2,(H,12,13)/t3-,6-/m1/s1 | | InChIKey | OQSAFIZCBAZPMY-AWFVSMACSA-N | | SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(Cl)=C2C(O)=O | | CAS DataBase Reference | 53994-69-7(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT |
| | 7-Amino-3-chloro cephalosporanic acid Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 7-Amino-3-chloro cephalosporanic acid is used as an intermediate in the preparation of semi-synthetic cephalosprin antibiotics. |
| | 7-Amino-3-chloro cephalosporanic acid Preparation Products And Raw materials |
|