|
|
| | 5-Iodo-1H-pyrrolo[2,3-b]pyridine Basic information | | Uses |
| | 5-Iodo-1H-pyrrolo[2,3-b]pyridine Chemical Properties |
| Melting point | 196-197°C | | density | 2.082±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 13.02±0.40(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C7H5IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10) | | InChIKey | CYMDPTJBUBTWEY-UHFFFAOYSA-N | | SMILES | C12NC=CC1=CC(I)=CN=2 |
| Hazard Codes | Xi,Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2933399990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 5-Iodo-1H-pyrrolo[2,3-b]pyridine Usage And Synthesis |
| Uses | 5-Iodo-7-azaindole is a 5-halogenated nitrogen heterocyclic indole. 5-Halo-nitrogen heterocyclic indoles, especially 5-chloro-aza-indoles and 5-bromo-aza-indoles, are important pharmaceutical and chemical raw materials, used to synthesize drugs such as Vemurafenib (Zelbora), an anticancer drug developed by Roche, and SGS-393, developed by Novartis. |
| | 5-Iodo-1H-pyrrolo[2,3-b]pyridine Preparation Products And Raw materials |
|