|
|
| | 1,3,5-Benzenetricarboxylic acid chloride Basic information |
| Product Name: | 1,3,5-Benzenetricarboxylic acid chloride | | Synonyms: | 1,3,5-BENZENETRICARBONYL TRICHLORIDE, 98;1,3,5-Bnezenetricarbonyltrichloride;1,3,5-Trichlorobenzoylchloride;1,3,5-Benzenetricarbonylchloride,98+%;Trimesoyl trichloride;1,3,5-Benzene;1,3,5-BENZENETRICARBOXYLICACIDTRICHLORIDE;Benzene-1,3,5-tricarbonyl chloride, Trimesic acid trichloride, Trimesoyl chloride | | CAS: | 4422-95-1 | | MF: | C9H3Cl3O3 | | MW: | 265.48 | | EINECS: | 224-594-8 | | Product Categories: | bc0001 | | Mol File: | 4422-95-1.mol |  |
| | 1,3,5-Benzenetricarboxylic acid chloride Chemical Properties |
| Melting point | 32-38 °C (lit.) | | Boiling point | 180 °C/16 mmHg (lit.) | | density | 1.487 g/mL at 25 °C (lit.) | | refractive index | 1.5945-1.5965 | | Fp | >230 °F | | storage temp. | Store below +30°C. | | solubility | decomposes | | form | Liquid | | color | Clear colorless to slightly yellow | | Water Solubility | decomposes | | Sensitive | Moisture Sensitive | | BRN | 2940936 | | InChI | 1S/C9H3Cl3O3/c10-7(13)4-1-5(8(11)14)3-6(2-4)9(12)15/h1-3H | | InChIKey | UWCPYKQBIPYOLX-UHFFFAOYSA-N | | SMILES | ClC(=O)c1cc(cc(c1)C(Cl)=O)C(Cl)=O | | CAS DataBase Reference | 4422-95-1(CAS DataBase Reference) | | NIST Chemistry Reference | 1,3,5-Benzenetricarbonyl trichloride(4422-95-1) | | EPA Substance Registry System | 1,3,5-Benzenetricarbonyl trichloride (4422-95-1) |
| Hazard Codes | C | | Risk Statements | 14-22-34 | | Safety Statements | 26-36/37/39-45-24/25 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 10-19 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29173980 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
Skin Sens. 1 |
| | 1,3,5-Benzenetricarboxylic acid chloride Usage And Synthesis |
| Chemical Properties | clear yellow liquid after melting | | Uses | Specialty organic. | | Uses | 1,3,5-Benzenetricarbonyl trichloride was used in the synthesis of chiral azoaromatic dendrimeric systems. It was used to study the structure of activated composite membranes containing organophosphorus extractants as carriers. It was the starting material for two tritopic amides derived from 3- and 4-methylaminopyridine which self-assembled into nanoballs on treatment with palladium(II) nitrate in DMSO. | | General Description | 1,3,5-Benzenetricarbonyl trichloride reacts with propargyl alcohol to yield triprop-2-ynyl benzene-1,3,5-tricarboxylate. |
| | 1,3,5-Benzenetricarboxylic acid chloride Preparation Products And Raw materials |
| Raw materials | Benzene, 1,3,5-tris(trichloromethyl)--->Trimesic acid | | Preparation Products | 1,3,5-Tris(bromomethyl)benzene-->TRIMETHYL 1,3,5-BENZENETRICARBOXYLATE-->5,5',5''-((benzene-1,3,5-tricarbonyl)tris(azanediyl))triisophthalic acid |
|