| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
- Trimethyl Trimesate
-
- $20.00
-
2024-04-25
- CAS:2672-58-4
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 200000kg
|
| | Trimethyl 1,3,5-benzenetricarboxylate Basic information |
| Product Name: | Trimethyl 1,3,5-benzenetricarboxylate | | Synonyms: | benzene-1,3,5-tricarboxylic acid trimethyl ester;Trimethyl 1,3,5-benzenetricarboxylate 99%;1,3,5-Benzenetri(carboxylic acid methyl) ester;1,3,5-Benzenetricarboxylic acid trimethyl;1,3,5-Benzenetris(carboxylic acid methyl) ester;Trimethyl 1,3,5-benzenetricarboxylate,99%;5-benzene tricarboxylate;TriMethyl 1 | | CAS: | 2672-58-4 | | MF: | C12H12O6 | | MW: | 252.22 | | EINECS: | 220-215-5 | | Product Categories: | Pyridines ,Halogenated Heterocycles;Aromatic Esters;C12 to C63;Carbonyl Compounds;Esters | | Mol File: | 2672-58-4.mol |  |
| | Trimethyl 1,3,5-benzenetricarboxylate Chemical Properties |
| Melting point | 145-147 °C(lit.) | | Boiling point | 230°C/0.5mmHg(lit.) | | density | 1.241 | | refractive index | 1.5230 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline Powder or Crystals | | color | White to almost white | | λmax | 282nm(CH3CN)(lit.) | | BRN | 2219698 | | InChI | InChI=1S/C12H12O6/c1-16-10(13)7-4-8(11(14)17-2)6-9(5-7)12(15)18-3/h4-6H,1-3H3 | | InChIKey | RGCHNYAILFZUPL-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)=CC(C(OC)=O)=CC(C(OC)=O)=C1 | | CAS DataBase Reference | 2672-58-4(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29173990 | | Storage Class | 11 - Combustible Solids |
| | Trimethyl 1,3,5-benzenetricarboxylate Usage And Synthesis |
| Chemical Properties | white to almost white crystalline powder or | | Uses | Trimethyl 1,3,5-benzenetricarboxylate has been used to synthesize yttrium trimesates with open frameworks. |
| | Trimethyl 1,3,5-benzenetricarboxylate Preparation Products And Raw materials |
| Raw materials | 3-Pyrrolidin-1-ylacrylic acid methyl ester-->Trimethyl 1,2,4-benzenetricarboxylate-->1,2,3-Benzenetricarboxylic acid-->1,3,5-Benzenetricarboxylic acid chloride-->Sulfuric acid-->Methanol-->Trimesic acid-->Iodomethane-->acrylic acid methyl ester-->Methyl propiolate | | Preparation Products | 1,3,5-Tris(bromomethyl)benzene-->Triethyl 1,3,5-benzenetricarboxylate-->Methyl 3,3-dimethoxypropionate |
|