|
|
| | BOC-(R)-3-AMINO-4-(2-NAPHTHYL)-BUTYRIC ACID Basic information |
| | BOC-(R)-3-AMINO-4-(2-NAPHTHYL)-BUTYRIC ACID Chemical Properties |
| Boiling point | 527.9±43.0 °C(Predicted) | | density | 1.179 | | storage temp. | 2-8°C | | pka | 4.42±0.10(Predicted) | | form | powder | | Appearance | White to off-white Solid | | Major Application | peptide synthesis | | InChI | 1S/C19H23NO4/c1-19(2,3)24-18(23)20-16(12-17(21)22)11-13-8-9-14-6-4-5-7-15(14)10-13/h4-10,16H,11-12H2,1-3H3,(H,20,23)(H,21,22)/t16-/m1/s1 | | InChIKey | RKULNBHGHIPRGC-MRXNPFEDSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)Cc1ccc2ccccc2c1 | | CAS DataBase Reference | 219297-10-6(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | F | 10 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | BOC-(R)-3-AMINO-4-(2-NAPHTHYL)-BUTYRIC ACID Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-(R)-3-AMINO-4-(2-NAPHTHYL)-BUTYRIC ACID Preparation Products And Raw materials |
|