|
|
| | Boc-D-beta-homophenylalanine Basic information |
| | Boc-D-beta-homophenylalanine Chemical Properties |
| Melting point | 100-102oC | | Boiling point | 444.8±38.0 °C(Predicted) | | density | 1.139±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 4.43±0.10(Predicted) | | form | Solid | | color | Off-White | | InChI | InChI=1/C15H21NO4/c1-15(2,3)20-14(19)16-12(10-13(17)18)9-11-7-5-4-6-8-11/h4-8,12H,9-10H2,1-3H3,(H,16,19)(H,17,18)/t12-/s3 | | InChIKey | ACKWQHCPHJQANL-PLAQIDKDNA-N | | SMILES | [C@@H](CC(=O)O)(NC(=O)OC(C)(C)C)CC1=CC=CC=C1 |&1:0,r| | | CAS DataBase Reference | 101555-61-7(CAS DataBase Reference) |
| Hazard Codes | Xn | | Risk Statements | 22 | | Safety Statements | 24/25 |
| | Boc-D-beta-homophenylalanine Usage And Synthesis |
| Uses | Boc-D-β-homophenylalanine is used in the synthesis of dipeptidyl peptidase IV inhibitors. | | Synthesis | Boc-D-beta-homophenylalanine is an amino acid derivative that can be prepared from D-phenylalanine as a raw material by a four-step reaction. |
| | Boc-D-beta-homophenylalanine Preparation Products And Raw materials |
|