|
|
| | 3,6-Dichlorophthalic anhydride Basic information |
| Product Name: | 3,6-Dichlorophthalic anhydride | | Synonyms: | 1,3-Isobenzofurandione, 4,7-dichloro-;3,6-DICHLOROPHTHALIC ANHYDRIDE;4,7-dichloroisobenzofuran-1,3-dione;3,6-DICHLOROPHTHALIC ANHYDRIDE ---WHITE POWDER, 98%---;4,7-Dichloro-1,3-isobenzofurandione;4,7-dichloro-2-benzofuran-1,3-dione;4,7-dichloroisobenzofuran-1,3-quinone;4,7-dichloro-1,3-dihydro-2-benzofuran-1,3-dione | | CAS: | 4466-59-5 | | MF: | C8H2Cl2O3 | | MW: | 217.01 | | EINECS: | 224-733-2 | | Product Categories: | Anhydride Monomers;Monomers;Polymer Science | | Mol File: | 4466-59-5.mol |  |
| | 3,6-Dichlorophthalic anhydride Chemical Properties |
| Melting point | 188-190 °C(lit.) | | Boiling point | 339.1°C (rough estimate) | | density | 1.5974 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly, Heated) | | form | Solid | | color | White to Off-White | | BRN | 164697 | | Stability: | Moisture Sensitive | | InChI | 1S/C8H2Cl2O3/c9-3-1-2-4(10)6-5(3)7(11)13-8(6)12/h1-2H | | InChIKey | HEGLMCPFDADCAQ-UHFFFAOYSA-N | | SMILES | Clc1ccc(Cl)c2C(=O)OC(=O)c12 | | CAS DataBase Reference | 4466-59-5(CAS DataBase Reference) | | NIST Chemistry Reference | 3,6-Dichloro-phthalic anhydride(4466-59-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-21 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,6-Dichlorophthalic anhydride Usage And Synthesis |
| Chemical Properties | off-white to white powder | | Uses | 3,6-Dichlorophthalic Anhydride is an intermediate in the synthesis of phthalic compounds, phthalazines, and quinones with antimicrobial activity. | | Purification Methods | Boil the anhydride in xylene (allowing any vapours which would contain H2O to be removed, e.g. Dean and Stark trap), which causes any acid present to dehydrate to the anhydride, and cool. Recrystallise it from xylene [Villiger Chem Ber 42 3539 1909, Fedoorow Izv Akad Nauk SSSR Otd Khim Nauk 397 1948, Chem Abstr 1585 1948]. [Beilstein 17/11 V 260.] |
| | 3,6-Dichlorophthalic anhydride Preparation Products And Raw materials |
|