- Phthalhydrazide
-
-
2026-06-30
- CAS:1445-69-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1000kg
- Phthalhydrazide
-
- $2.60
-
2026-05-28
- CAS:1445-69-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 5000kg
- Phthalhydrazide
-
-
2026-03-20
- CAS:1445-69-8
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20 mt
|
| | Phthalhydrazide Basic information |
| Product Name: | Phthalhydrazide | | Synonyms: | PHTALYLHYDRAZINE;PHTHALHYDRAZIDE;PHTHALHYDRAZINE;PHTHALOYLHYDRAZINE;1,4-Ketophthalazine;1,4-phthalazinediol;2,3-dihydro-4-phthalazinedione;n,n’-phthaloylhydrazine | | CAS: | 1445-69-8 | | MF: | C8H6N2O2 | | MW: | 162.15 | | EINECS: | 215-893-4 | | Product Categories: | | | Mol File: | 1445-69-8.mol |  |
| | Phthalhydrazide Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 288.82°C (rough estimate) | | density | 1.3264 (rough estimate) | | refractive index | 1.5770 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in acetone and acetic acid. | | form | Powder and Chunks | | pka | 10.70±0.20(Predicted) | | color | White | | BRN | 135926 | | InChI | InChI=1S/C8H6N2O2/c11-7-5-3-1-2-4-6(5)8(12)10-9-7/h1-4H,(H,9,11)(H,10,12) | | InChIKey | KGLPWQKSKUVKMJ-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)NN1 | | CAS DataBase Reference | 1445-69-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | RTECS | TH8890080 | | HS Code | 29280000 | | Storage Class | 11 - Combustible Solids | | Toxicity | mouse,LD50,intraperitoneal,700mg/kg (700mg/kg),Archiv der Pharmazie Vol. 327, Pg. 237, 1994. |
| | Phthalhydrazide Usage And Synthesis |
| Chemical Properties | WHITE POWDER AND CHUNKS | | Uses | Phthalic Hydrazide is a reagent in the synthesis in various pyrazolophthalazine derivatives. | | Uses | Phthalhydrazide is a reagent used in the synthesis of various pyrazolophthalazine derivatives is and used in medicine double hydrazine phthalocyanine work intermediates. | | Synthesis Reference(s) | Journal of Heterocyclic Chemistry, 5, p. 111, 1968 DOI: 10.1002/jhet.5570050120 | | Synthesis Reference(s) | Journal of the American Chemical Society, 84, p. 966, 1962 DOI: 10.1021/ja00865a018 | | Purification Methods | Recrystallise it twice from 0.1M KOH [Merenyi et al. J Am Chem Soc 108 7716 1986], EtOH or dimethylformamide and it sublimes >300o. [Beilstein 24 H 371, 24 II 194.] |
| | Phthalhydrazide Preparation Products And Raw materials |
|