|
|
| | Trimethyl-d9-amine Basic information |
| | Trimethyl-d9-amine Chemical Properties |
| Melting point | −117 °C(lit.) | | Boiling point | 3-4 °C(lit.) | | density | 0.734 g/mL at 25 °C(lit.) | | vapor density | 2.09 (vs air) | | vapor pressure | 13.3 psi ( 21 °C) | | Fp | 20 °F | | form | solid | | Stability: | Stable. Extremely flammable. Incompatible with strong oxidizing agents, acids, acid anhydrides, many metals and alloys, bases, acid chlorides. | | InChI | 1S/C3H9N/c1-4(2)3/h1-3H3/i1D3,2D3,3D3 | | InChIKey | GETQZCLCWQTVFV-GQALSZNTSA-N | | SMILES | [2H]C([2H])([2H])N(C([2H])([2H])[2H])C([2H])([2H])[2H] | | CAS Number Unlabeled | 75-50-3 |
| | Trimethyl-d9-amine Usage And Synthesis |
| | Trimethyl-d9-amine Preparation Products And Raw materials |
|