- (S)-Butyl 2-hydroxybutanoate
-
- $3.90 / 100KG
-
2025-10-13
- CAS:132513-51-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | (S)-Butyl 2-hydroxybutanoate Basic information |
| | (S)-Butyl 2-hydroxybutanoate Chemical Properties |
| Boiling point | 205℃ | | density | 0.989 | | Fp | 79℃ | | storage temp. | 2-8°C | | pka | 13.06±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H16O3/c1-3-5-6-11-8(10)7(9)4-2/h7,9H,3-6H2,1-2H3/t7-/m0/s1 | | InChIKey | YFFBWGUXPFAXRS-ZETCQYMHSA-N | | SMILES | C(OCCCC)(=O)[C@@H](O)CC |
| | (S)-Butyl 2-hydroxybutanoate Usage And Synthesis |
| Uses | (S)-Butyl 2-hydroxybutanoate is a derivative of 2-hydroxybutanoate, which is optically active and is an industrially important compound as a raw material for pharmaceuticals and pesticides or as a raw material for photographic chemicals. |
| | (S)-Butyl 2-hydroxybutanoate Preparation Products And Raw materials |
|