|
|
| | N-(2-aminoethyl)piperazine-1,4-diethylamine Basic information |
| Product Name: | N-(2-aminoethyl)piperazine-1,4-diethylamine | | Synonyms: | N-(2-aminoethyl)piperazine-1,4-diethylamine;1,4-Piperazinediethanamine, N-(2-aminoethyl)-;N-(2-Aminoethyl)-1,4-piperazinediethanamine;aminoethylpiperazinylethylethylenediamine;1-(2-Aminoethyl)-4-[(2-aminoethyl)amino]ethylpiperazine;N1-(2-Aminoethyl)-1,4-piperazinediethanamine;N-(2-AMinoethyl)piperazin-1,4-diethanaMine;N1-(2-(4-(2-aMinoethyl)piperazin-1-yl)ethyl)ethane-1,2-diaMine | | CAS: | 31295-54-2 | | MF: | C10H25N5 | | MW: | 215.34 | | EINECS: | 250-557-0 | | Product Categories: | | | Mol File: | 31295-54-2.mol |  |
| | N-(2-aminoethyl)piperazine-1,4-diethylamine Chemical Properties |
| Boiling point | 348.8±10.0 °C(Predicted) | | density | 1.011 | | storage temp. | 2-8°C | | pka | 10.11±0.10(Predicted) | | InChI | InChI=1S/C10H25N5/c11-1-3-13-4-6-15-9-7-14(5-2-12)8-10-15/h13H,1-12H2 | | InChIKey | CXNQJNPKMZRHBC-UHFFFAOYSA-N | | SMILES | C(NCCN1CCN(CCN)CC1)CN | | EPA Substance Registry System | 1,4-Piperazinediethanamine, N-(2-aminoethyl)- (31295-54-2) |
| RIDADR | 2735 | | TSCA | TSCA listed | | HazardClass | 8 | | PackingGroup | III |
| | N-(2-aminoethyl)piperazine-1,4-diethylamine Usage And Synthesis |
| Description | 2-(4-{2-[(2-aminoethyl)amino]ethyl}piperazin-1-yl)ethan-1-amine is a precuers for the synthesis of lipid C12-200 for LNP drug delievery. The amino groups are reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. | | Uses | N1-(2-(4-(2-Aminoethyl)piperazin-1-yl)ethyl)ethane-1,2-diamine (CAS# 31295-54-2) is used in preparation of lipid-like materials for low-dose, in vivo gene silencing. |
| | N-(2-aminoethyl)piperazine-1,4-diethylamine Preparation Products And Raw materials |
|