|
|
| | N2,N2-dimethylpropane-1,2-diamine Basic information |
| Product Name: | N2,N2-dimethylpropane-1,2-diamine | | Synonyms: | N2,N2-dimethylpropane-1,2-diamine;1-Amino-2-(dimethylamino)propane;2-(Dimethylamino)-1-propanamine;(2-amino-1-methylethyl)dimethylamine(SALTDATA: FREE);N,N-DiMethylpropane-1,2-diaMine;(2-amino-1-methyl-ethyl)-dimethyl-amine;[2-(N,N-Dimethyl)]-1,2-propanediamine;2-N,2-N-dimethylpropane-1,2-diamine | | CAS: | 19764-58-0 | | MF: | C5H14N2 | | MW: | 102.18 | | EINECS: | 243-280-1 | | Product Categories: | | | Mol File: | 19764-58-0.mol |  |
| | N2,N2-dimethylpropane-1,2-diamine Chemical Properties |
| Boiling point | 104.9±8.0 °C(Predicted) | | density | 0.834±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.62±0.10(Predicted) | | InChI | InChI=1S/C5H14N2/c1-5(4-6)7(2)3/h5H,4,6H2,1-3H3 | | InChIKey | WNLWBCIUNCAMPH-UHFFFAOYSA-N | | SMILES | C(N)C(N(C)C)C | | EPA Substance Registry System | 1,2-Propanediamine, N2,N2-dimethyl- (19764-58-0) |
| TSCA | TSCA listed | | HazardClass | IRRITANT |
| | N2,N2-dimethylpropane-1,2-diamine Usage And Synthesis |
| Uses | N-(2-amino-1-methylethyl)-N,N-dimethylamine is a useful research chemical used in the preparation and synthesis of 17-aminogeldanamycin derivatives fir Hsp90 binding and antitumor activity. |
| | N2,N2-dimethylpropane-1,2-diamine Preparation Products And Raw materials |
|