|
|
| | N-Carbobenzoxy-L-isoleucine dicyclohexylammonium salt Basic information |
| | N-Carbobenzoxy-L-isoleucine dicyclohexylammonium salt Chemical Properties |
| Melting point | 159-160 °C | | storage temp. | Inert atmosphere,2-8°C | | form | Powder | | color | Off-white to white | | InChIKey | QWMHUFMEYKIYPC-VOLJOMRMNA-N | | SMILES | N(C1CCCCC1)C1CCCCC1.[C@H](C(=O)O)(NC(=O)OCC1C=CC=CC=1)[C@@H](C)CC |&1:13,28,r| | | CAS DataBase Reference | 26699-00-3(CAS DataBase Reference) |
| WGK Germany | 3 | | HS Code | 2922.49.8000 |
| | N-Carbobenzoxy-L-isoleucine dicyclohexylammonium salt Usage And Synthesis |
| Chemical Properties | White powder | | Uses | N-Cbz-L-isoleucine is an N-Cbz-protected form of L-Isoleucine (I820175). L-Isoleucine is classified as an essential amino acid, and is also a tumour promoter of bladder cancer in rats. |
| | N-Carbobenzoxy-L-isoleucine dicyclohexylammonium salt Preparation Products And Raw materials |
|