| Company Name: |
Merck KGaA |
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Company Name: |
SIGMA-RBI |
| Tel: |
800 736 3690 (Orders) |
| Email: |
|
|
| | L-Leucine-2-13C Basic information |
| | L-Leucine-2-13C Chemical Properties |
| Melting point | >300 °C(lit.) | | form | solid | | Optical Rotation | [α]25/D +14.5°, c = 2 in 5 M HCl | | InChI | 1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1/i5+1 | | InChIKey | ROHFNLRQFUQHCH-IJPZVAHNSA-N | | SMILES | [H][13C@](N)(CC(C)C)C(O)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | L-Leucine-2-13C Usage And Synthesis |
| Uses | L-Leucine-2-13C is the 13C-labeled L-Leucine. L-Leucine is an essential branched-chain amino acid (BCAA), which activates the mTOR signaling pathway[1]. | | References | [1] Russak EM, et al. Impact of Deuterium Substitution on the Pharmacokinetics of Pharmaceuticals. Ann Pharmacother. 2019;53(2):211-216. DOI:10.1177/1060028018797110 |
| | L-Leucine-2-13C Preparation Products And Raw materials |
|