H-DL-GLA-OH manufacturers
- h-dl-gla-oh
-
- $1.00 / 1KG
-
2019-12-23
- CAS:56271-99-9
- Min. Order: 1g
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | H-DL-GLA-OH Basic information |
| Product Name: | H-DL-GLA-OH | | Synonyms: | DL-GAMMA-CARBOXYGLUTAMIC ACID;DL-GAMMA-CARBOXYGLUTAMIC ACID, MONOAMMONIUM SALT;GAMMA-CARBOXY-DL-GLUTAMIC ACID;GLA;H-DL-GLA-OH;H-DL-GLU(GAMMA-COOH)-OH;H-G-CARBOXY-DL-GLU-OH;H-G-CARBOXY-DL-GLUTAMIC ACID | | CAS: | 56271-99-9 | | MF: | C6H9NO6 | | MW: | 191.14 | | EINECS: | 260-087-8 | | Product Categories: | | | Mol File: | 56271-99-9.mol |  |
| | H-DL-GLA-OH Chemical Properties |
| Boiling point | 418.0±45.0 °C(Predicted) | | density | 1.649±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 2.13±0.10(Predicted) | | BRN | 2214048 | | Major Application | peptide synthesis | | InChI | 1S/C6H9NO6/c7-3(6(12)13)1-2(4(8)9)5(10)11/h2-3H,1,7H2,(H,8,9)(H,10,11)(H,12,13) | | InChIKey | UHBYWPGGCSDKFX-UHFFFAOYSA-N | | SMILES | NC(CC(C(O)=O)C(O)=O)C(O)=O |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | H-DL-GLA-OH Usage And Synthesis |
| Chemical Properties | Crystalline | | Uses | peptide synthesis | | reaction suitability | reaction type: solution phase peptide synthesis |
| | H-DL-GLA-OH Preparation Products And Raw materials |
|