- FMOC-GLA(OTBU)2-OH
-
-
2020-01-09
- CAS:111662-64-7
- Min. Order: 500g
- Purity: 98%; 99%
- Supply Ability: 500g;1kg; 10kg; 25kg
|
| | Fmoc-Gla(OtBu)2-OH Basic information |
| | Fmoc-Gla(OtBu)2-OH Chemical Properties |
| Melting point | 102-104°C | | Boiling point | 695.3±55.0 °C(Predicted) | | density | 1.217 | | storage temp. | Sealed in dry,2-8°C | | form | solid | | pka | 3.50±0.10(Predicted) | | Major Application | peptide synthesis | | InChIKey | XJRUHYXXHXECDI-CRPMJUFNNA-N | | SMILES | C1(COC(=O)N[C@H](C(=O)O)CC(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C2=CC=CC=C2C2C=CC=CC1=2 |&1:6,r| | | CAS DataBase Reference | 111662-64-7(CAS DataBase Reference) |
| WGK Germany | WGK 2 | | HazardClass | IRRITANT | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Gla(OtBu)2-OH Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Solid | | Uses | A protected L-γ-Carboxyglutamic Acid. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Gla(OtBu)2-OH Preparation Products And Raw materials |
|