- Desoxyrhaponticin
-
- $81.00
-
2026-07-27
- CAS:30197-14-9
- Purity: 99.97%
- Supply Ability: 10g
- Desoxyrhaponticin
-
-
2026-06-30
- CAS:30197-14-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 20Tons
|
| | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucoside Basic information |
| Product Name: | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucoside | | Synonyms: | deoxyrhapontin from rhubarb root;3,5-dihydroxy-4'-methoxystilbene 3-o-β-d-glucoside;(E)-4'-Methoxy-5-(β-D-glucopyranosyloxy)stilbene-3-ol;3-(β-D-Glucopyranosyloxy)-5-[(E)-2-(4-methoxyphenyl)vinyl]phenol;3-Hydroxy-5-[(E)-2-(4-methoxyphenyl)ethenyl]phenyl β-D-glucopyranoside;DEOXYRHAPONTIN(RG);Deoxyrhapontigenin O-glucoside;Rhaponticin, 98%, from Rheum officinale Baill. | | CAS: | 30197-14-9 | | MF: | C21H24O8 | | MW: | 404.41 | | EINECS: | 200-258-5 | | Product Categories: | | | Mol File: | 30197-14-9.mol |  |
| | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucoside Chemical Properties |
| Melting point | 219-220 °C | | Boiling point | 700.5±60.0 °C(Predicted) | | density | 1.433±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Soluble in ethanol; very ; practically insoluble in dichloromethane | | form | powder | | pka | 9.19±0.10(Predicted) | | color | White-yellow | | Water Solubility | slightly soluble in water | | Major Application | food and beverages | | InChI | InChI=1/C21H24O8/c1-27-15-6-4-12(5-7-15)2-3-13-8-14(23)10-16(9-13)28-21-20(26)19(25)18(24)17(11-22)29-21/h2-10,17-26H,11H2,1H3/b3-2+/t17-,18-,19+,20-,21-/s3 | | InChIKey | MFMQRDLLSRLUJY-UPCKEZSENA-N | | SMILES | [C@@H]1([C@H](O)[C@H]([C@H](O)[C@@H](CO)O1)O)OC1=CC(=CC(/C=C/C2=CC=C(OC)C=C2)=C1)O |&1:0,1,3,4,6,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucoside Usage And Synthesis |
| Chemical Properties | Yellow crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Rhubarb Rumex madaio MakinoR. daiwoo Makino. | | Uses | Deoxyrhaponticin is an impurity of Rhaponticin (R316000), a stilbene derivative found in Rheum. It is an inhibitor of Tyrosinase which is responsible for the molting process in insects, undesirable browning of fruits and vegetables, and coloring of skin, hair, and eyes in animals. | | Definition | ChEBI: Desoxyrhaponticin is a stilbenoid and a glycoside. | | in vivo | Desoxyrhaponticin (150, 300 mg/kg; po; single dose before the glucose loading) inhibits intestinal and renal glucose transport in normal and diabetic rats, and reduces postprandial hyperglycemia in diabetic rat[2].
|
| | 3,5-Dihydroxy-4'-methoxystilbene 3-O-beta-D-glucoside Preparation Products And Raw materials |
|