|
|
| | 4,6-O-Ethylidene-alpha-D-glucose Basic information |
| Product Name: | 4,6-O-Ethylidene-alpha-D-glucose | | Synonyms: | (2R,3R)-2,3-dihydroxy-3-((4R,5R)-5-hydroxy-2-methyl-1,3-dioxan-4-yl)propanal;(4aR,6S,7R,8R,8aS)-2-Methylhexahydropyrano[3,2-d][1,3]dioxine-6,7,8-triol;(4AR,7R,8R,8aS)-2-Methylhexahydropyrano-[3,2-d][1,3]dioxine-6,7,8-triol;NSC 89726;-D-glucopyranose;4,6-O-Ethylidene-α4,6-O-ETHYLIDENE-A-D-GLUCOSE;4,6-O-ETHYLIDENE-ALPHA-D-GLUCOPYRANOSE | | CAS: | 13224-99-2 | | MF: | C8H14O6 | | MW: | 206.19 | | EINECS: | 236-198-2 | | Product Categories: | Carbohydrate Synthesis;Specialty Synthesis;Monosaccharides;Sugars;Sugars, Carbohydrates & Glucosides;Biochemistry;Glucose;O-Substituted Sugars | | Mol File: | 13224-99-2.mol |  |
| | 4,6-O-Ethylidene-alpha-D-glucose Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 386.6±42.0 °C(Predicted) | | density | 1.446±0.06 g/cm3(Predicted) | | Fp | >110°(230°F) | | solubility | Ethanol, Water | | pka | 12.01±0.70(Predicted) | | form | Powder | | color | White to Off-white | | Water Solubility | almost transparency | | InChI | 1S/C8H14O6/c1-3-12-2-4-7(13-3)5(9)6(10)8(11)14-4/h3-11H,2H2,1H3/t3,4-,5-,6-,7-,8+/m1/s1 | | InChIKey | VZPBLPQAMPVTFO-NKWOADHPSA-N | | SMILES | CC1OC[C@H]2O[C@H](O)[C@H](O)[C@@H](O)[C@@H]2O1 | | LogP | 0.54 | | CAS DataBase Reference | 13224-99-2(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29400090 | | Storage Class | 11 - Combustible Solids |
| | 4,6-O-Ethylidene-alpha-D-glucose Usage And Synthesis |
| Uses | 4,6-O-Ethylidene-D-glucose is an intermediate in synthesizing α-Etoposide (E933745), which is a cytotoxic agent (anticancer drug), which belongs to the drug type topoisomerase inhibitor. It is also an antineoplastic drug. | | IC 50 | GLUT1; Human Endogenous Metabolite |
| | 4,6-O-Ethylidene-alpha-D-glucose Preparation Products And Raw materials |
|