|
|
| | (S)-Amino-(4-chloro-phenyl)-acetic acid Basic information |
| Product Name: | (S)-Amino-(4-chloro-phenyl)-acetic acid | | Synonyms: | (4-CHLOROPHENYL)GLYCINE;(S)-4-CHLOROPHENYL GLYCINE;PARACHLOROPHENYLGLYCINE;AMINO-(4-CHLORO-PHENYL)-ACETIC ACID;L-4-CHLOROPHENYLGLYCINE;H-PHG(4-CL)-OH;L-4-Cl-Phg-OH;L-2-(4-Chlorophenyl)glycine | | CAS: | 67336-19-0 | | MF: | C8H8ClNO2 | | MW: | 185.61 | | EINECS: | | | Product Categories: | | | Mol File: | 67336-19-0.mol |  |
| | (S)-Amino-(4-chloro-phenyl)-acetic acid Chemical Properties |
| Melting point | 229 °C | | Boiling point | 328.8±32.0 °C(Predicted) | | density | 1.392±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | powder to crystal | | pka | 1.81±0.10(Predicted) | | color | White to Almost white | | InChI | InChI=1/C8H8ClNO2/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7H,10H2,(H,11,12)/t7-/s3 | | InChIKey | QGJGBYXRJVIYGA-KPOCXSGKNA-N | | SMILES | C(O)(=O)[C@@H](N)C1=CC=C(Cl)C=C1 |&1:3,r| | | CAS DataBase Reference | 67336-19-0(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 25 | | Safety Statements | 45 | | HS Code | 2922498590 |
| | (S)-Amino-(4-chloro-phenyl)-acetic acid Usage And Synthesis |
| Uses | L-4-Chlorophenylglycine is used to prepare carbohydrates as templates. |
| | (S)-Amino-(4-chloro-phenyl)-acetic acid Preparation Products And Raw materials |
|