| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Boc-2,4-dichloro-L-phenylalanine Basic information |
| Product Name: | Boc-2,4-dichloro-L-phenylalanine | | Synonyms: | N-Boc-2,4-dichloro-L-phenylalanine, 95%;Boc-Phe(2,4-Cl2)-OH;(S)-2-((tert-Butoxycarbonyl)aMino)-3-(2,4-dichlorophenyl)propanoic acid;Boc-Phe(2,4-Cl2)-OH Boc-2,4-Dichloro-L-Phenylalanin;(S)-Boc-2-amino-3-(2,4-dichlorophenyl)propionic acid;Boc-2,4-dichloro-L-phenylalanine≥ 99% (HPLC);(R)-BOC-2,4-DICHLOROPHENYLALANINE;RARECHEM BK PT 0110 | | CAS: | 114873-04-0 | | MF: | C14H17Cl2NO4 | | MW: | 334.2 | | EINECS: | | | Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;Amino Acid Derivatives;Peptide;a-amino;Amino Acids | | Mol File: | 114873-04-0.mol |  |
| | Boc-2,4-dichloro-L-phenylalanine Chemical Properties |
| Melting point | 133-137 °C | | Boiling point | 476.1±45.0 °C(Predicted) | | density | 1.323±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.78±0.12(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | [α]20/D 31±3°, c = 1% in methanol | | Major Application | peptide synthesis | | InChI | 1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)6-8-4-5-9(15)7-10(8)16/h4-5,7,11H,6H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 | | InChIKey | KSDWBXFRQWMWHO-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(Cl)cc1Cl)C(O)=O | | CAS DataBase Reference | 114873-04-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29223900 | | Storage Class | 11 - Combustible Solids |
| | Boc-2,4-dichloro-L-phenylalanine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-2,4-dichloro-L-phenylalanine Preparation Products And Raw materials |
|