| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- BOC-L-2-Chlorophe
-
- $1.00
-
2019-07-06
- CAS:114873-02-8
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 100KG
|
| | BOC-L-2-Chlorophe Basic information |
| | BOC-L-2-Chlorophe Chemical Properties |
| Melting point | 94-100 °C | | alpha | -33 º (c=1,EtOH) | | Boiling point | 452.5±40.0 °C(Predicted) | | density | 1.245±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 3.83±0.11(Predicted) | | form | powder | | color | Off-white | | Optical Rotation | [α]20/D 24.5±1°, c = 1% in ethyl acetate | | BRN | 8778440 | | Major Application | peptide synthesis | | InChI | 1S/C14H18ClNO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-6-4-5-7-10(9)15/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | TUUQJNHCVFJMPU-NSHDSACASA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1Cl)C(O)=O | | CAS DataBase Reference | 114873-02-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 11 - Combustible Solids |
| | BOC-L-2-Chlorophe Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-L-2-Chlorophe Preparation Products And Raw materials |
|