|
|
| | GR 64349 Basic information |
| Product Name: | GR 64349 | | Synonyms: | L-Lys-L-Asp-L-Ser-L-Phe-L-Val-N-[(3R)-1-[(R)-1-[[[(S)-1-(Aminocarbonyl)-3-(methylthio)propyl]amino]carbonyl]-3-methylbutyl]-2-oxo-3α-pyrrolidinyl]-NH2;L-Methioninamide,L-lysyl-L-a-aspartyl-L-seryl-L-phenylalanyl-L-valyl-(aS,3R)-3-amino-a-(2-methylpropyl)-2-oxo-1-pyrrolidineacetyl-;LYS-ASP-SER-PHE-VAL-GLY-R-GAMMA-LACTAM-LEU-MET-NH2;[LYS3, GLY8-R-GAMMA-LACTAM-LEU9]NEUROKININ A (3-10);GR 64349;L-lysyl-L-α-aspartyl-L-seryl-L-phenylalanyl-L-valyl-(αS,3R)-3-amino-α-(2-methylpropyl)-2-oxo-1-pyrrolidineacetyl-L-methioninamide;GR-64349
(GR64349);L-Methioninamide, L-lysyl-L-α-aspartyl-L-seryl-L-phenylalanyl-L-valyl-(αS,3R)-3-amino-α-(2-methylpropyl)-2-oxo-1-pyrrolidineacetyl- | | CAS: | 137593-52-3 | | MF: | C42H68N10O11S | | MW: | 921.11 | | EINECS: | | | Product Categories: | AgonistPeptides for Cell Biology;Neuropeptides;Peptides for Cell Biology;Tachykinins | | Mol File: | 137593-52-3.mol |  |
| | GR 64349 Chemical Properties |
| Boiling point | 1342.8±65.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | Soluble to 1 mg/ml in 20% ethanol / water | | form | Powder | | pka | 4.13±0.10(Predicted) | | color | White to off-white | | Water Solubility | Soluble to 1 mg/ml in water | | Sequence | Lys-Asp-Ser-Phe-Val-{Aaa}-Leu-Met-NH2 | | InChIKey | HVUNRXRFMQDMBO-NOJSRKIXSA-N | | SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)N1CC[C@H](NC(=O)[C@@H](NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CO)NC(=O)[C@H](CC(O)=O)NC(=O)[C@@H](N)CCCCN)C(C)C)C1=O)C(N)=O |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | GR 64349 Usage And Synthesis |
| Uses | GR 64349 acts as a potent and selective agonist at the NK-2 tachykinin receptor. Initiates changes in the colon, intestine and spinal cord. | | Biological Activity | GR 64349 peptide acts as an agonist of neurokinin (NK2) receptor, which leads to reduced NK2 response to kainate and AMPA (α-amino-3-hydroxy-5-methyl-4-isoxazolepropionic acid), but not to NMDA (N-methyl-D-aspartate). | | storage | Store at -20°C |
| | GR 64349 Preparation Products And Raw materials |
|