| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
BINDONE manufacturers
- BINDONE
-
- $1.00
-
2020-02-02
- CAS:1707-95-5
- Min. Order: 1KG
- Purity: 99%HPLC
- Supply Ability: 200KG
|
| | BINDONE Basic information |
| Product Name: | BINDONE | | Synonyms: | 2-(3-oxo-1-indanylidene)-1,3-indandione;2-(3-oxo-1-indanylidene)-3-indandione;2-(3-OXO-1-INDANYLIDENE)INDAN-1,3-DIONE;2-[1-(-3-OXOINDANYLIDENE)]-1,3-INDANEDIONE;Bindone [for Detection of Primary Amines];2-(2,3-Dihydro-3-oxo-1H-inden-1-ylidene)-1H-indene-1,3(2H)-dione;Δ1,2'(3'H)-Bi[1H-indene]-1',3,3'(2H)-trione;Δ1,2'-Biindan-1',3,3'-trione | | CAS: | 1707-95-5 | | MF: | C18H10O3 | | MW: | 274.27 | | EINECS: | 216-956-9 | | Product Categories: | | | Mol File: | 1707-95-5.mol |  |
| | BINDONE Chemical Properties |
| Melting point | 205-208°C | | Boiling point | 357.26°C (rough estimate) | | density | 1.2968 (rough estimate) | | refractive index | 1.4700 (estimate) | | storage temp. | Store at room temperature | | color | Yellow plates | | BRN | 1884961 | | InChI | InChI=1S/C18H10O3/c19-15-9-14(10-5-1-2-6-11(10)15)16-17(20)12-7-3-4-8-13(12)18(16)21/h1-8H,9H2 | | InChIKey | YMFDOLAAUHRURP-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C=CC=C2)C(=O)/C/1=C1/C2=C(C=CC=C2)C(=O)C/1 |
| RTECS | NK6050000 | | Toxicity | LDLo ipr-mus: 100 mg/kg ARTODN 33,191,75 |
| Provider | Language |
|
ALFA
| English |
| | BINDONE Usage And Synthesis |
| Safety Profile | Poison by intraperitoneal route. An experimental teratogen. Experimental reproductive effects. When heated to decomposition it emits acrid smoke and irritating fumes. |
| | BINDONE Preparation Products And Raw materials |
|