- 3'-Methoxy Puerarin
-
-
2023-02-24
- CAS:117047-07-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
- 3''-METHOXYPUERARIN
-
- $3.00
-
2020-01-17
- CAS:117047-07-1
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 1kg,5kg,50kg
|
| | 3''-METHOXYPUERARIN Basic information |
| Product Name: | 3''-METHOXYPUERARIN | | Synonyms: | 8-beta-D-Glucopyranosyl-7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-4H-1-benzopyran-4-one;Methoxypuerarin, 3'-;4H-1-Benzopyran-4-one,8-b-D-glucopyranosyl-7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-;4H-1-Benzopyran-4-one, 8-β-D-glucopyranosyl-7-hydroxy-3-(4-hydroxy-3-methoxyphenyl)-;3'-Methoxypuerarin,Inhibitor,3'Methoxypuerarin,inhibit,3' Methoxypuerarin;3'-Methoxypuerarin;3''-METHOXYPUERARIN;7-Hydroxy-3-(4-hydroxy-3-methoxyphenyl)-8-((2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)-4H-chromen-4-one | | CAS: | 117047-07-1 | | MF: | C22H22O10 | | MW: | 446.4 | | EINECS: | | | Product Categories: | Iso-Flavones | | Mol File: | 117047-07-1.mol |  |
| | 3''-METHOXYPUERARIN Chemical Properties |
| Melting point | 212-213℃ | | Boiling point | 706.0±60.0 °C(Predicted) | | density | 1.583 | | solubility | Soluble in methanol; | | form | powder | | pka | 6.30±0.20(Predicted) | | color | White | | Water Solubility | insoluble in water | | InChIKey | HQQUZVFMUSCUJS-PGPONNFDSA-N | | SMILES | O1[C@@H]([C@H]([C@@H]([C@H]([C@@H]1c2c3[o]cc([c](c3ccc2O)=O)c4cc(c(cc4)O)OC)O)O)O)CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 3''-METHOXYPUERARIN Usage And Synthesis |
| Uses | 3''-Methoxypuerarin treats ischemia cerebrovascular disease. | | in vivo | 3'-Methoxypuerarin increases the number of surviving neurons in the hippocampal CA1 region and markedly reduces the number of apoptotic pyramidal neurons after ischemia/reperfusion injury. 3'-Methoxypuerarin can protect hippocampal neurons against I/R injury by inhibiting apoptosis[1]. | | target | NO | ROS |
| | 3''-METHOXYPUERARIN Preparation Products And Raw materials |
|