| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
(-)-TEPHROSIN manufacturers
- Tephrosin
-
- $979.00
-
2026-07-27
- CAS:76-80-2
- Purity:
- Supply Ability: 10g
- Tephrosin
-
- $979.00
-
2025-07-17
- CAS:76-80-2
- Purity:
- Supply Ability: 10g
|
| | (-)-TEPHROSIN Basic information |
| Product Name: | (-)-TEPHROSIN | | Synonyms: | 13,13a-Dihydro-7a-hydroxy-9,10-dimethoxy-3,3-dimethyl-3H-bis[1]benzopyrano[3,4-b:6',5'-e]pyran-7(7aH)-one;Hydroxydeguelin;Isotephrosin;Deguelinol I;Tephrosin (synthetic);3H-Bis[1]benzopyrano[3,4-b:6',5'-e]pyran-7- (7aH)-one,13,13a-dihydro-7a-hydroxy-9,10- dimethoxy-3,3-dimethyl-,(7aR,13aR)-;Tephrosin >=95% (LC/MS-ELSD);(-)-TEPHROSIN USP/EP/BP | | CAS: | 76-80-2 | | MF: | C23H22O7 | | MW: | 410.42 | | EINECS: | | | Product Categories: | Miscellaneous Natural Products | | Mol File: | 76-80-2.mol |  |
| | (-)-TEPHROSIN Chemical Properties |
| Melting point | 198° (218-220°) | | Boiling point | 450.42°C (rough estimate) | | density | 1.2284 (rough estimate) | | refractive index | 1.5300 (estimate) | | storage temp. | -20°C | | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | | form | Cryst. | | pka | 10.47±0.40(Predicted) | | color | White to off-white | | Major Application | metabolomics
vitamins, nutraceuticals, and natural products | | InChI | 1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 | | InChIKey | AQBZCCQCDWNNJQ-AUSIDOKSSA-N | | SMILES | COc1cc2OC[C@H]3Oc4c(ccc5OC(C)(C)C=Cc45)C(=O)[C@@]3(O)c2cc1OC |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| | (-)-TEPHROSIN Usage And Synthesis |
| Uses | Tephrosin as a natural rotenoid obtained from Tephrosia vogelii and displays anticancer activity. | | Definition | ChEBI: A member of the class of rotenones that is 13,13a-dihydro-3H-chromeno[3,4-b]pyrano[2,3-h]chromen-7(7aH)-one substituted with geminal methyl groups at position 3, hydroxy group at position 7a a
d methoxy groups at positions 9 and 10 (the 7aR,13aR stereoisomer). It is isolated from the leaves and twigs of Antheroporum pierrei and exhibits antineoplastic and pesticidal activities. | | Biological Activity | Tephrosin is a plant-based rotenoid which has known anti-cancer properties. Tephrosin inhibited proliferation in A549 cancer cells in a dose-sependent manner. Tephrosin has been shown to induce capase-independent apoptosis, and internalization and degradation of inactivated EGFR and ErB2 in human colon cancer cells. | | target | ROS | PARP | Autophagy | HSP (e.g. HSP90) | EGFR | Akt | ERK | Caspase | AMPK | mTOR |
| | (-)-TEPHROSIN Preparation Products And Raw materials |
|