4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester manufacturers
|
| | 4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester Basic information |
| Product Name: | 4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester | | Synonyms: | 4-chloro-2-benzothiophenecarboxylic acid methyl ester;4-chlorobenzothiophene-2-carboxylic acid methyl ester;Benzo[b]thiophene-2-carboxylicacid, 4-chloro-, methyl ester;methyl 4-chlorobenzothiophene-2-carboxylate;Trimethadione Impurity 7 | | CAS: | 35212-95-4 | | MF: | C10H7ClO2S | | MW: | 226.68 | | EINECS: | 218-944-9 | | Product Categories: | | | Mol File: | 35212-95-4.mol | ![4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester Structure](CAS/GIF/35212-95-4.gif) |
| | 4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester Chemical Properties |
| Melting point | 95-97° | | Boiling point | 338.7±22.0 °C(Predicted) | | density | 1.391±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C10H7ClO2S/c1-13-10(12)9-5-6-7(11)3-2-4-8(6)14-9/h2-5H,1H3 | | InChIKey | CKXPDFHEOUVFRD-UHFFFAOYSA-N | | SMILES | C12=CC=CC(Cl)=C1C=C(C(OC)=O)S2 |
| HazardClass | IRRITANT | | HS Code | 2934999090 |
| | 4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester Usage And Synthesis |
| Uses | Methyl 4-Chlorobenzo[b]thiophene-2-carboxylate is a reactant in the synthesis of novel tachykinin NK2 receptor antagonists. | | References | [1] Patent: WO2016/191366, 2016, A1. Location in patent: Page/Page column 34; 35 [2] Journal of Medicinal Chemistry, 2007, vol. 50, # 20, p. 4793 - 4807 [3] Bioorganic and Medicinal Chemistry Letters, 2005, vol. 15, # 12, p. 2998 - 3001 |
| | 4-Chloro-benzo[b]thiophene-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|