- Isostearic acid
-
-
2026-09-11
- CAS:2724-58-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 1000kg
- ISOSTEARIC ACID
-
-
2026-06-30
- CAS:2724-58-5
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
- Isostearic Acid
-
- $10.70
-
2026-05-28
- CAS:2724-58-5
- Min. Order: 10kg
- Purity: 99%
- Supply Ability: 10000kg
|
| | Isostearic acid Basic information |
| Product Name: | Isostearic acid | | Synonyms: | 16-methyl-heptadecanoicaci;Heptadedecanoicacid,16-Methyl;isostearic;ISOOCTADECANOIC ACID;ISOSTEARIC ACID MIXED ISOMERS;Heptadecanoic acid, 16-methyl-;Isostearinsure;16-METHYLHEPTADECANOIC ACID | | CAS: | 2724-58-5 | | MF: | C18H36O2 | | MW: | 284.48 | | EINECS: | 220-336-3 | | Product Categories: | 2724-58-5 | | Mol File: | 2724-58-5.mol |  |
| | Isostearic acid Chemical Properties |
| Melting point | 67.8-68.5 °C | | Boiling point | 369.53°C (estimate) | | density | 0.89 g/mL at 25 °C(lit.) | | refractive index | 1.4440 (estimate) | | storage temp. | 2-8°C | | pka | 4.78±0.10(Predicted) | | form | Liquid | | color | Colorless to light yellow | | Odor | Typical | | Stability: | Stable. Combustible. Incompatible with bases, strong oxidizing agents. | | Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
BINDING
CLEANSING
SURFACTANT - EMULSIFYING | | Cosmetic Ingredient Review (CIR) | ISOSTEARIC ACID (2724-58-5) | | InChI | InChI=1S/C18H36O2/c1-17(2)15-13-11-9-7-5-3-4-6-8-10-12-14-16-18(19)20/h17H,3-16H2,1-2H3,(H,19,20) | | InChIKey | XDOFQFKRPWOURC-UHFFFAOYSA-N | | SMILES | C(O)(=O)CCCCCCCCCCCCCCC(C)C | | LogP | 7.674 (est) |
| WGK Germany | 3 | | RTECS | MI3875000 | | Storage Class | 11 - Combustible Solids |
| | Isostearic acid Usage And Synthesis |
| Chemical Properties | solid | | Uses | Similar to stearic or oleic acids. | | Uses | Isostearic acid (16-Methylheptadecanoic acid) is used in the synthesis of methyl-branched poly(hydroxyalkanoate)s, biosurfactants and silver nanoparticles. | | Definition | ChEBI: A methyl-branched fatty acid that is heptadecanoic acid (margaric acid) substituted by a methyl group at position 16. | | in vivo | Isostearic acid (625 mg/kg, applied to skin) induces psoriaform disease in mice, with activating an inflammasome response |
| | Isostearic acid Preparation Products And Raw materials |
|