3-Bromo-7-nitroindazole manufacturers
|
| | 3-Bromo-7-nitroindazole Basic information |
| | 3-Bromo-7-nitroindazole Chemical Properties |
| Melting point | 175-185 °C | | Boiling point | 182°C | | density | 1.8856 (rough estimate) | | refractive index | 1.6200 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | solubility | ethanol: 25 mg/mL | | form | powder | | pka | 7.85±0.40(Predicted) | | color | light yellow | | Sensitive | Light Sensitive | | InChI | InChI=1S/C7H4BrN3O2/c8-7-4-2-1-3-5(11(12)13)6(4)9-10-7/h1-3H,(H,9,10) | | InChIKey | NFSTZPMYAZRZPC-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2[N+]([O-])=O)C(Br)=N1 | | CAS DataBase Reference | 74209-34-0(CAS DataBase Reference) |
| Hazard Codes | T | | Risk Statements | 60 | | Safety Statements | 53-22-36/37/39-45 | | WGK Germany | 3 | | Hazard Note | Harmful to reproduction | | HazardClass | IRRITANT | | HS Code | 2933998090 |
| | 3-Bromo-7-nitroindazole Usage And Synthesis |
| Chemical Properties | Yellow Crystals | | Uses | A more potent inhibitor of rat cerebellar nitric oxide synthase than 7-nitroindazole | | Uses | Inhibitor of nitric oxide synthase (NOS) | | Uses | 3-Bromo-7-nitroindazole is a potent and selective neuronal nitric oxide synthase (nNOS) inhibitor (1,2). It is also a neuroprotective compound that inhibits the endoplasmic reticulum stress pathway. 3-Bromo-7-nitroindazole has been used to study the role of nitric oxide synthase (nNOS) in spatial memory formation in rats (2). | | IC 50 | nNOS | | storage | Desiccate at +4°C |
| | 3-Bromo-7-nitroindazole Preparation Products And Raw materials |
|