- Potassium DL-Aspartate
-
-
2026-07-29
- CAS:923-09-1
- Min. Order: 1kg
- Purity: 99%-102%; DAB10
- Supply Ability: 20 tons
|
| | Potassium hydrogen DL-aspartate Basic information |
| Product Name: | Potassium hydrogen DL-aspartate | | Synonyms: | mono-Potassiumd,l-aspartate;potassium hydrogen DL-aspartate;DL-Aspartic acid Potassium salt Hemihydrate;DL-Aspartic acid hemihydrate potassium salt;PotassiuM 3-aMino-3-carboxypropanoate;potassium 3-amino-4-hydroxy-4-oxobutanoate;Potassium hydrogen DL-aspartate USP/EP/BP;DL-Aspartic acid (potassium) | | CAS: | 923-09-1 | | MF: | C4H6KNO4 | | MW: | 171.19 | | EINECS: | 213-088-2 | | Product Categories: | | | Mol File: | 923-09-1.mol |  |
| | Potassium hydrogen DL-aspartate Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C4H7NO4.K.H2O/c5-2(4(8)9)1-3(6)7;;/h2H,1,5H2,(H,6,7)(H,8,9);;1H2/q;+1;/p-1 | | InChIKey | RYXUAPZBZMSTCP-UHFFFAOYSA-M | | SMILES | C(N)(C([O-])=O)CC(=O)O.[K+].O |
| | Potassium hydrogen DL-aspartate Usage And Synthesis |
| | Potassium hydrogen DL-aspartate Preparation Products And Raw materials |
|