- Cbz-L-Glu(Otbu)
-
- $1.00
-
2020-01-06
- CAS:3886-08-6
- Min. Order: 1g
- Purity: 98%
- Supply Ability: 100KG
|
| | N-Cbz-L-Glutamic acid 5-tert-butyl ester Basic information |
| | N-Cbz-L-Glutamic acid 5-tert-butyl ester Chemical Properties |
| Melting point | 83-87 °C | | alpha | -14 º (c=2% in MeOH) | | Boiling point | 522.6±50.0 °C(Predicted) | | density | 1+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | solubility | almost transparency in Methanol | | pka | 3.80±0.10(Predicted) | | form | powder to crystal | | color | White to Almost white | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C17H23NO6/c1-17(2,3)24-14(19)10-9-13(15(20)21)18-16(22)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,20,21)/t13-/m0/s1 | | InChIKey | GLMODRZPPBZPPB-ZDUSSCGKSA-N | | SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)NC(OCC1=CC=CC=C1)=O | | CAS DataBase Reference | 3886-08-6(CAS DataBase Reference) |
| | N-Cbz-L-Glutamic acid 5-tert-butyl ester Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | N-Cbz-L-Glutamic acid 5-tert-butyl ester is a white to pale yellow crystalline powder with good thermal and chemical stability. As an essential raw material for peptide synthesis and intermediate for drug development, N-Cbz-L-Glutamic acid 5-tert-butyl ester has broad application prospects in the fields of chemistry and biomedicine.
|
| | N-Cbz-L-Glutamic acid 5-tert-butyl ester Preparation Products And Raw materials |
|