|
|
| | 2,3-Dichloro-5,6-diphenylpyrazine Basic information |
| Product Name: | 2,3-Dichloro-5,6-diphenylpyrazine | | Synonyms: | 2,3-Dichloro-5,6-diphenylpyrazine;Selexipag impurity 3/2,3-dichloro-5,6-diphenylpyrazine;Selexipag Impurity 9;Pyrazine, 2,3-dichloro-5,6-diphenyl- | | CAS: | 57038-62-7 | | MF: | C16H10Cl2N2 | | MW: | 301.17 | | EINECS: | | | Product Categories: | | | Mol File: | 57038-62-7.mol |  |
| | 2,3-Dichloro-5,6-diphenylpyrazine Chemical Properties |
| Melting point | 190-191 °C(Solv: hexane (110-54-3)) | | Boiling point | 376.8±37.0 °C(Predicted) | | density | 1.307±0.06 g/cm3(Predicted) | | pka | -5.29±0.10(Predicted) | | InChI | InChI=1S/C16H10Cl2N2/c17-15-16(18)20-14(12-9-5-2-6-10-12)13(19-15)11-7-3-1-4-8-11/h1-10H | | InChIKey | WFCQMAPVGQKSBR-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C2=CC=CC=C2)=C(C2=CC=CC=C2)N=C1Cl |
| | 2,3-Dichloro-5,6-diphenylpyrazine Usage And Synthesis |
| | 2,3-Dichloro-5,6-diphenylpyrazine Preparation Products And Raw materials |
|