| Company Name: |
Shanghai Taopu Industrial Co., LTD Gold
|
| Tel: |
159-00573766 18018507602 |
| Email: |
394643792@qq.com |
| Products Intro: |
Product Name:1-Ethoxycarbonyl-beta-carbolinecarboline
CAS:72755-19-2
Purity:98% Package:10mg;20mg;50mg;1G;5G;34G
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Carboline Impurity 1
CAS:72755-19-2
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
| Company Name: |
Wuhan ChemFaces Biochemical Co., Ltd.
|
| Tel: |
18607101326 15172504745 |
| Email: |
aileen@chemfaces.com |
| Products Intro: |
Product Name:1-Ethoxycarbonyl-beta-carboline
CAS:72755-19-2
Purity:>=98% Package:5mg ,10mg ,20mg ,50mg ,100mg; 200mg; 500mg,可根据客户需求定制 Remarks:2478/5mg
|
|
| | 1-(Ethoxycarbonyl)-β-carboline Basic information |
| Product Name: | 1-(Ethoxycarbonyl)-β-carboline | | Synonyms: | 1-(Ethoxycarbonyl)-β-carboline;1-Ethoxycarbonyl-beta-carboline;ethyl 9H-pyrido[3,4-b]indole-1-carboxylate;9H-Pyrido[3,4-b]indole-1-carboxylic acid ethyl ester;1-Ethoxycarbonyl-beta-carbolinecarboline;Carboline Impurity 1;1-Ethoxycarbonyl-β-carboline;1-Ethoxycarbonyl-β-carbolinecarboline | | CAS: | 72755-19-2 | | MF: | C14H12N2O2 | | MW: | 240.26 | | EINECS: | | | Product Categories: | | | Mol File: | 72755-19-2.mol |  |
| | 1-(Ethoxycarbonyl)-β-carboline Chemical Properties |
| Melting point | 145-146 °C | | Boiling point | 470.9±25.0 °C(Predicted) | | density | 1.308±0.06 g/cm3(Predicted) | | form | Solid | | pka | 14.21±0.40(Predicted) | | color | Light yellow to orange | | InChI | InChI=1S/C14H12N2O2/c1-2-18-14(17)13-12-10(7-8-15-13)9-5-3-4-6-11(9)16-12/h3-8,16H,2H2,1H3 | | InChIKey | CFXOOHNXLDSCHT-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC=C2)C2C=CN=C(C(OCC)=O)C1=2 |
| | 1-(Ethoxycarbonyl)-β-carboline Usage And Synthesis |
| Uses | Kumujian A (1-Ethoxycarbonyl-β-carboline), an anti-inflammatory agent, inhibits both superoxide anion generation (IC50 = 4.87 μg/mL) and elastase release (IC50 = 6.29 μg/mL)[1]. | | References | [1] Fang HW, et al. Total synthesis of cordatanine, structural reassignment of drymaritin, and anti-inflammatory activity of synthetic precursors. Bioorg Med Chem Lett. 2015 Sep 15;25(18):3822-4. DOI:10.1016/j.bmcl.2015.07.074 |
| | 1-(Ethoxycarbonyl)-β-carboline Preparation Products And Raw materials |
|