|
|
| | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID Basic information |
| Product Name: | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID | | Synonyms: | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID;N-Fmoc-12-amino-4,7,10-trioxadodecanoic acid;FMoc-NH-PEG3-CH2CH2COOH;1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic acid;Fmoc-N-amido-PEG3-acid;Fmoc-PEG3- CH2CH2COOH;Fmoc-PEG3-OH
1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic acid;Fmoc-PEG3-propionic acid | | CAS: | 867062-95-1 | | MF: | C24H29NO7 | | MW: | 443.49 | | EINECS: | | | Product Categories: | peg | | Mol File: | 867062-95-1.mol |  |
| | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID Chemical Properties |
| Melting point | 43-46°C | | Boiling point | 651.9±55.0 °C(Predicted) | | density | 1.230 | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 4.28±0.10(Predicted) | | color | White | | Major Application | peptide synthesis | | InChI | InChI=1S/C24H29NO7/c26-23(27)9-11-29-13-15-31-16-14-30-12-10-25-24(28)32-17-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-8,22H,9-17H2,(H,25,28)(H,26,27) | | InChIKey | CHIDDYZONKDHLG-UHFFFAOYSA-N | | SMILES | C(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)(=O)NCCOCCOCCOCCC(O)=O |
| WGK Germany | WGK 2 | | HS Code | 29225090 | | Storage Class | 11 - Combustible Solids |
| | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID Usage And Synthesis |
| Description | Fmoc-N-amido-PEG3-acid is a PEG linker containing an Fmoc-protected amine and a terminal carboxylic acid. The hydrophilic PEG spacer increases solubility in aqueous media. The Fmoc group can be deprotected under basic condition to obtain the free amine which can be used for further conjugations. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | White powder | | Uses | 1-(9H-Fluoren-9-yl)-3-oxo-2,7,10,13-tetraoxa-4-azahexadecan-16-oic Acid has been used as a reactant for the preparation of vaccines. | | reaction suitability | reaction type: Pegylations | | IC 50 | Cleavable Linker; PEGs |
| | FMOC-12-AMINO-4,7,10-TRIOXADODECANOIC ACID Preparation Products And Raw materials |
|