|
|
| | 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester Basic information |
| Product Name: | 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester | | Synonyms: | 2-(4-Morphelino)pyrimidine-5-boronic acid pinacol ester;9 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester;2-Morpholino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine;2-Morpholino-4-pyrimidine-5-boronic acid pinacol ester;4-(5-(4,4,5,5-TetraMethyl-1,3,2-dioxaborolan-2-yl)pyriMidin-2-yl)Morpholine;2-(4-Morpholino)pyrimidine-5-boronic acid, pinacol eser;2-(4-Morpholino)pyrimidine-5-boronic acid, pinacol ester 97%;2-(Morpholino)pyrimidine-5-boronic acid pinacol ester | | CAS: | 957198-30-0 | | MF: | C14H22BN3O3 | | MW: | 291.15 | | EINECS: | | | Product Categories: | Organoborons;Pyrimidine | | Mol File: | 957198-30-0.mol |  |
| | 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester Chemical Properties |
| density | 1.16 | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C14H22BN3O3/c1-13(2)14(3,4)21-15(20-13)11-9-16-12(17-10-11)18-5-7-19-8-6-18/h9-10H,5-8H2,1-4H3 | | InChIKey | HNVAYPJNFUXYII-UHFFFAOYSA-N | | SMILES | CC1(C)OB(C2=CN=C(N=C2)N3CCOCC3)OC1(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | WGK 3 | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester Usage And Synthesis |
| Synthesis | 4-(5-bromopyrimidin-2-yl)morpholine (2.01 g, 8.23 mmol), pinacol ester of bis(boronic acid) (3.8 g, 15 mmol), potassium acetate (2.5 g, 25 mmol) and Pd(dppf)Cl2 (0.61 g, 0.83 mmol) were mixed in 1,4-dioxane (30 mL). The reaction mixture was stirred at 90 °C overnight under nitrogen protection. After completion of the reaction, the mixture was cooled to room temperature and diluted with water (20 mL). The reaction mixture was extracted with dichloromethane (30 mL x 3). The organic layers were combined, dried with anhydrous sodium sulfate and concentrated under reduced pressure. The residue was purified by silica gel column chromatography with petroleum ether/ethyl acetate (v/v = 7/3) as eluent to give a white solid product (0.4 g, 88% yield). m/z MS (ESI, cationic): 292.0 [M + 1]+. | | References | [1] Patent: WO2016/615, 2016, A1. Location in patent: Paragraph 00730 |
| | 2-(4-Morpholino)pyrimidine-5-boronic acid pinacol ester Preparation Products And Raw materials |
|