|
|
| | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL Basic information |
| Product Name: | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL | | Synonyms: | 5-(1,1-DIMETHYL-HEPTYL)BENZENE-1,3-DIOL;5-(1,1-DIMETHYL-HEPTYL)RESORCINOL;5-(1,1-Dimethylheptyl)-1,3-benzenediol;5-(1,1-Dimethylheptyl)resorcino;1,3-Benzenediol, 5-(1,1-dimethylheptyl)-;5-(1,1-DiMethylheptyl)resorcinol(for Nabilone);Resorcinol Impurity 21;5-(1,1-dimethylheptyl)metabenzenediphenol | | CAS: | 56469-10-4 | | MF: | C15H24O2 | | MW: | 236.35 | | EINECS: | 260-193-4 | | Product Categories: | Aromatics;Intermediates;Intermediates & Fine Chemicals;Pharmaceuticals;API intermediates;Intermediate | | Mol File: | 56469-10-4.mol |  |
| | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL Chemical Properties |
| Melting point | 88-90°C | | Boiling point | 161-163 °C(Press: 0.5 Torr) | | density | 1.003±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 9.51±0.10(Predicted) | | color | Off-White to Light Beige | | InChI | InChI=1S/C15H24O2/c1-4-5-6-7-8-15(2,3)12-9-13(16)11-14(17)10-12/h9-11,16-17H,4-8H2,1-3H3 | | InChIKey | GWBGUJWRDDDVBI-UHFFFAOYSA-N | | SMILES | C1(O)=CC(C(C)(C)CCCCCC)=CC(O)=C1 | | CAS DataBase Reference | 56469-10-4(CAS DataBase Reference) |
| Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | HS Code | 2907.29.9000 |
| | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL Usage And Synthesis |
| Chemical Properties | Off-White to Light Beige Solid | | Uses | Nabilone intermediate. |
| | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL Preparation Products And Raw materials |
|