|
|
| | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN& Basic information | | Application |
| Product Name: | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN& | | Synonyms: | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN&;5-(1,1-dimethylheptyl)-1,3-dimethoxybenzene;5-(1,1-dimethylheptyl)3,5-dimethoxybenzene;3-(1,1-DIMETHYL-HEPTYL)-5-METHOXYANISOLE;1,3-DiMethoxy-5-(2-Methyloctan-2-yl)benzene;1-(1,1-Dimethylheptyl)-3,5-dimethoxybenzene;Einecs 262-280-2;Benzene, 1-(1,1-dimethylheptyl)-3,5-dimethoxy- | | CAS: | 60526-81-0 | | MF: | C17H28O2 | | MW: | 264.4 | | EINECS: | 262-280-2 | | Product Categories: | Building Blocks;C15 to C19;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Ethers;Organic Building Blocks;Oxygen Compounds | | Mol File: | 60526-81-0.mol |  |
| | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN& Chemical Properties |
| Boiling point | 122 °C/0.5 mmHg (lit.) | | density | 0.943 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.500(lit.) | | Fp | >230 °F | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | InChI | 1S/C17H28O2/c1-6-7-8-9-10-17(2,3)14-11-15(18-4)13-16(12-14)19-5/h11-13H,6-10H2,1-5H3 | | InChIKey | MYYOUJBZUGHFNX-UHFFFAOYSA-N | | SMILES | CCCCCCC(C)(C)c1cc(OC)cc(OC)c1 |
| WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN& Usage And Synthesis |
| Application | 1-(1,1-dimethylheptyl)-3,5-dimethoxybenzene is a hydrocarbon derivative and can be used as an organic intermediate. | | Synthesis | 1-(1,1-dimethylheptyl)-3,5-dimethoxybenzene can be prepared from 2-octanone as starting material by a four-step reaction. |
| | 1-(1 1-DIMETHYLHEPTYL)-3 5-DIMETHOXYBEN& Preparation Products And Raw materials |
| Raw materials | 4-(1',1'-dimethylheptyl)-2,6-dimethoxyphenyl diethylphosphate-->Benzeneacetaldehyde, α-hexyl-3,5-dimethoxy-α-methyl--->Hydrazinecarboxamide, 2-[2-(3,5-dimethoxyphenyl)-2-methyloctylidene]--->1-(3 5-DIMETHOXYPHENYL)HEPTAN-1-ONE 96-->2-METHYL-2-OCTANOL-->2,6-dimethoxy-4-(2-methyloctan-2-yl)phenyl trifluoromethanesulfonate-->2,6-dimethoxy-4-(2-methyloctan-2-yl)phenol-->2,6-Dimethoxyphenol-->Dimethyl sulfate-->DIMETHYLZINC-->Trimethylaluminium | | Preparation Products | 5-(1,1-DIMETHYL-HEPTYL)RESORCINOL |
|