|
|
| | 2-Acetyl-6-methoxynaphthalene Basic information |
| | 2-Acetyl-6-methoxynaphthalene Chemical Properties |
| Melting point | 107-109 °C(lit.) | | Boiling point | 155-160°C 0,4mm | | density | 1.0907 (rough estimate) | | vapor pressure | 0.009Pa at 25℃ | | refractive index | 1.5906 (estimate) | | Fp | 155-160°C/0.4mm | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Powder | | color | Light yellow-beige | | Water Solubility | 760mg/L at 27℃ | | BRN | 1871098 | | InChI | InChI=1S/C13H12O2/c1-9(14)10-3-4-12-8-13(15-2)6-5-11(12)7-10/h3-8H,1-2H3 | | InChIKey | GGWCZBGAIGGTDA-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C2C(=C1)C=CC(OC)=C2)C | | LogP | 1.52 at 27℃ | | CAS DataBase Reference | 3900-45-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 37/38-36/37/38 | | Safety Statements | 37/39-26-36/37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29145000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 |
| | 2-Acetyl-6-methoxynaphthalene Usage And Synthesis |
| Chemical Properties | Light yellow-beige powder | | Uses | Naproxen impurity L. Naproxen USP Related Compound L | | General Description | 6′-Methoxy-2′-acetonaphthone (6-methoxy-2-naphthylacetic acid ) is metabolite of nabumetone, a phototoxic nonsteroidal antiinflammatory drug.1 | | Flammability and Explosibility | Non flammable |
| | 2-Acetyl-6-methoxynaphthalene Preparation Products And Raw materials |
|