| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
|
| | Desmethyl trimebutine HCl Basic information |
| | Desmethyl trimebutine HCl Chemical Properties |
| Melting point | 90-92°C | | storage temp. | Refrigerator | | solubility | DMSO, Methanol (Sparingly) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C21H27NO5.ClH/c1-6-21(22-2,16-10-8-7-9-11-16)14-27-20(23)15-12-17(24-3)19(26-5)18(13-15)25-4;/h7-13,22H,6,14H2,1-5H3;1H | | InChIKey | CTXAQAVYYROYHX-UHFFFAOYSA-N | | SMILES | C(C1C=CC=CC=1)(NC)(CC)COC(C1C=C(OC)C(OC)=C(OC)C=1)=O.Cl |
| | Desmethyl trimebutine HCl Usage And Synthesis |
| Chemical Properties | White Solid | | Uses | The main bioactive metabolite of Trimebutine. |
| | Desmethyl trimebutine HCl Preparation Products And Raw materials |
|