|
|
| | Syringaresinol-di-O-glucoside Basic information |
| Product Name: | Syringaresinol-di-O-glucoside | | Synonyms: | Syringaresinol-di-O-glucoside;(-)-syringaresinol O,O'-bis(beta-D-glucoside);(-)-syringaresinol O,O'-bis(β-D-glucoside);(-)-Syringaresinol 4,4-di-O-β-D-glucoside;4-{(1R,3aS,4R,6aS)-4-[4-(beta-D-glucopyranosyloxy)-3,5-dimethoxyphenyl]tetrahydro-1H,3H-furo[3,4-c]furan-1-yl}-2,6-dimethoxyphenyl beta-D-glucopyranoside;β-D-Glucopyranoside, [(1R,3aS,4R,6aS)-tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl]bis(2,6-dimethoxy-4,1-phenylene) bis-;(-)-Syringaresinol diglucoside;(-)-syringaresinolO,O'-bis(β-D-glucoside) | | CAS: | 66791-77-3 | | MF: | C34H46O18 | | MW: | 742.72 | | EINECS: | 2017-001-1 | | Product Categories: | | | Mol File: | 66791-77-3.mol |  |
| | Syringaresinol-di-O-glucoside Chemical Properties |
| Boiling point | 935.7±65.0 °C(Predicted) | | density | 1.474±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in methanol and water | | form | powder | | pka | 12.45±0.70(Predicted) | | color | White | | InChIKey | FFDULTAFAQRACT-NYYYOYJKSA-N | | SMILES | O1[C@H]([C@@H]([C@H]([C@@H]([C@H]1CO)O)O)O)Oc2c(cc(cc2OC)[C@@H]3OC[C@@H]4[C@H]3CO[C@H]4c5cc(c(c(c5)OC)O[C@@H]6O[C@@H]([C@H]([C@@H]([C@H]6O)O)O)CO)OC)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Syringaresinol-di-O-glucoside Usage And Synthesis |
| Uses | Syringaresinol diglucoside is a natural compound from bamboo leaves[1]. | | Definition | ChEBI: (-)-syringaresinol O,O'-bis(beta-D-glucoside) is a beta-D-glucoside that is the 4,4'-bis(beta-D-glucosyl) derivative of (-)-syringaresinol. It has a role as a plant metabolite, an antioxidant and an anti-inflammatory agent. It is functionally related to a (-)-syringaresinol. | | References | [1] Luo, G.-Y., et al. Antioxidant compounds from ethanol extracts of bamboo (Neosinocalamus affinis) leaves. Journal of Asian Natural Products Research, 2014;17(3), 248–255. |
| | Syringaresinol-di-O-glucoside Preparation Products And Raw materials |
|