|
|
| | 4-Amino-6-chloro-5-fluoropyrimidine Basic information |
| Product Name: | 4-Amino-6-chloro-5-fluoropyrimidine | | Synonyms: | 4-Amino-6-chloro-5-fluoropyrimidine;6-Chloro-5-fluoropyrimidin-4-amine;5-Amino-6-chloro-5-fluoropyrimidine;4-chloro-5-fluoro-6-aminopyrimidine;4-Pyrimidinamine, 6-chloro-5-fluoro-;4-Amino-6-chloro-5-fluoropyrimidine ISO 9001：2015 REACH;6-Chloro-5-fluoropyrimidine-4-amine;6-Chloro-5-fluoro-4-pyrimidinamine | | CAS: | 851984-15-1 | | MF: | C4H3ClFN3 | | MW: | 147.54 | | EINECS: | | | Product Categories: | Fluorine series;pyrimidine | | Mol File: | 851984-15-1.mol |  |
| | 4-Amino-6-chloro-5-fluoropyrimidine Chemical Properties |
| Boiling point | 275.2±35.0℃ (760 Torr) | | density | 1.564±0.06 g/cm3 (20 ºC 760 Torr) | | Fp | 120.3±25.9℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 0.27±0.10(Predicted) | | Appearance | White to light yellow Solid | | InChI | InChI=1S/C4H3ClFN3/c5-3-2(6)4(7)9-1-8-3/h1H,(H2,7,8,9) | | InChIKey | FEIFDRDCVMVUJA-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=C(F)C(N)=N1 |
| Safety Statements | 24/25 | | HazardClass | IRRITANT-HARMFUL, AVOID SKIN CONTACT | | HS Code | 29335990 |
| | 4-Amino-6-chloro-5-fluoropyrimidine Usage And Synthesis |
| Synthesis | General procedure for the synthesis of 4-amino-6-chloro-5-fluoropyrimidine from 4,6-dichloro-5-fluoropyrimidine: 4,6-dichloro-5-fluoropyrimidine (1.67 g, 10.0 mmol), n-butanol (6 mL), and 28% aqueous ammonium hydroxide (12 mL) were added to a sealed tube and mixed well. The reaction mixture was heated at 90 °C for 2 hours. After completion of the reaction, it was cooled to room temperature and the precipitated white crystals were collected by filtration to afford the target product 4-amino-6-chloro-5-fluoropyrimidine (1.31 g, 89% yield). The product was analyzed by LC-MS (ESI), m/z: 147.9 [M+H]+. | | References | [1] Patent: WO2012/35039, 2012, A1. Location in patent: Page/Page column 108-109
[2] Patent: US2009/36419, 2009, A1. Location in patent: Page/Page column 44
[3] Patent: WO2013/185082, 2013, A2. Location in patent: Page/Page column 47 |
| | 4-Amino-6-chloro-5-fluoropyrimidine Preparation Products And Raw materials |
|