|
|
| | 2-BroMoglutaric acid diethylester Basic information |
| Product Name: | 2-BroMoglutaric acid diethylester | | Synonyms: | 2-BroMoglutaric acid diethylester;Diethyl 2-bromoglutarate;Diethyl alpha-bromoglutarate;diethyl 2-bromopentanedioate;Pentanedioic acid, 2-bromo-, diethyl ester;diethyl 2-bromopentanodioate;Pentanedioic acid, 2-bromo-, 1,5-diethyl ester;1,5-Diethyl 2-bromopentanedioate | | CAS: | 7209-00-9 | | MF: | C9H15BrO4 | | MW: | 267.12 | | EINECS: | | | Product Categories: | | | Mol File: | 7209-00-9.mol |  |
| | 2-BroMoglutaric acid diethylester Chemical Properties |
| Boiling point | 142-148℃ | | density | 1.351±0.06 g/cm3(Predicted) | | refractive index | 1.457 (589.3 nm 20℃) | | storage temp. | Storage temp. 2-8°C | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H15BrO4/c1-3-13-8(11)6-5-7(10)9(12)14-4-2/h7H,3-6H2,1-2H3 | | InChIKey | OXJSWZSWGJACGU-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Br)CCC(OCC)=O |
| | 2-BroMoglutaric acid diethylester Usage And Synthesis |
| Uses |
2-BroMoglutaric acid diethylester is an ester derivative used in organic and pharmaceutical synthesis.
| | Hazard | 2-BroMoglutaric acid diethylester is harmful if swallowed and can cause severe skin burns and eye damage upon contact.
| | Chemical Properties |
2-BroMoglutaric acid diethylester can undergo complexation reaction with metal, alkali metal and other ions.
|
| | 2-BroMoglutaric acid diethylester Preparation Products And Raw materials |
|