- KukoaMine B
-
- $35.00
-
2026-07-31
- CAS:164991-67-7
- Purity: 99.59%
- Supply Ability: 10g
- Kukoamine B
-
- $3.00
-
2020-01-19
- CAS:164991-67-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1kg,5kg,50kg
|
| | KukoaMine B Basic information |
| Product Name: | KukoaMine B | | Synonyms: | KukoaMine B;Benzenepropanamide,N-(3-aminopropyl)-N-[4-[[3-[[3-(3,4-dihydroxyphenyl)-1-oxopropyl]amino]propyl]amino]butyl]-3,4-dihydroxy-;Kukoamine B-D8;Dihydroxybenzenepropanamide;N-(3-Aminopropyl)-3-(3,4-dihydroxyphenyl)-N-(4-((3-(3-(3,4-dihydroxyphenyl)propanamido)propyl)amino)butyl)propanamide;Geoscutin;Resorcinol Impurity 30;KukoaMine B (Standard) | | CAS: | 164991-67-7 | | MF: | C28H42N4O6 | | MW: | 530.66 | | EINECS: | | | Product Categories: | | | Mol File: | 164991-67-7.mol |  |
| | KukoaMine B Chemical Properties |
| Boiling point | 844.3±65.0 °C(Predicted) | | density | 1.232±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | -20°C | | solubility | DMF:30.0(Max Conc. mg/mL);56.53(Max Conc. mM) DMSO:30.0(Max Conc. mg/mL);56.53(Max Conc. mM) Ethanol:30.0(Max Conc. mg/mL);56.53(Max Conc. mM) PBS (pH 7.2):10.0(Max Conc. mg/mL);18.84(Max Conc. mM) Water:62.5(Max Conc. mg/mL);117.78(Max Conc. mM) | | form | A crystalline solid | | pka | 9.78±0.10(Predicted) | | color | White to off-white | | Major Application | food and beverages | | InChIKey | IWRAOCFRRTWUDF-UHFFFAOYSA-N | | SMILES | C1(CCC(N(CCCN)CCCCNCCCNC(=O)CCC2=CC=C(O)C(O)=C2)=O)=CC=C(O)C(O)=C1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | KukoaMine B Usage And Synthesis |
| Chemical Properties | White crystalline powder, soluble in organic solvents such as methanol, ethanol, DMSO, etc., derived from the bark of Lycium bark. | | Uses | Kukoamine B is an amide alkaloiad used in the protection against NMDA-induced neurotoxicity and potential harmful mechanisms. In addition it is seen to inhibit the inflammatory response in the livers of septic mice. | | Definition | ChEBI: Kukoamine B is an amine. | | in vivo | Kukoamine B (20, 50 mg/kg, i.g., daily, 9 weeks) reduces inflammation and blood glucose without body weight gain or liver mass increase[1].
Kukoamine B (2, 5 mg/kg, p.o., daily, 12 weeks) demonstrates the anti-osteoporotic effects in ovariectomized (OVX) mice[3].
Kukoamine B (1.25-60 mg/kg, i.v., only one injection or very 8 h for 3 days) protects mice challenged with E. coli and reduces the circulatory levels of LPS and TNF-a in sepsis model mice[4].
| Animal Model: | Male, 4-week old db/db mice (BKS.Cgm+/+Leprdb/J) and wildtype (WT) mice (C57BLKS/J-m+/+ db). A spontaneous type 2 diabetic animal model[1]. | | Dosage: | 20, 50 mg/kg | | Administration: | i.g., daily, 9 weeks | | Result: | Successfully controlled the augment of blood glucose with age increase.
Reduced levels of 29 inflammatory markers such as IL-2, IL-3, IL-4, IL-5, IL-6, IL-7 and IL8.
|
| Animal Model: | Seven-week-old female ddy mice underwent either an ovariectomy or sham-operated surgery[3]. | | Dosage: | 2, 5 mg/kg | | Administration: | p.o., daily, 12 weeks | | Result: | Inhibited the OVX-induced BMD loss in the right femur bone and restored the impaired bone structural properties of BV/TV, Tb.Th, Tb.N, and Tb.Sp.
|
| Animal Model: | Kunming (KM) mice, 4–6 weeks old, 18–20 g, male and female in equal number. Mice were injected with heat-killed E. coli (EC, 1.0 * 1011 CFUkg-1) in order to establish the sepsis model.[4]. | | Dosage: | 1.25, 2.5, 5, 10, 15, 30, 60 mg/kg | | Administration: | 80 mice (15, 30, 60 mg/kg), i.v., only one injection; 100 mice (1.25, 2.5, 5 mg/kg), i.v., every 8 h for 3 days; 96 mice, (60 mg/kg), i.v., once at 0, 2, 4, 6, 8 h after injection of EC. | | Result: | Significantly decreased the mortality rate from 87.5% to 62.5%, 62.5%, or 37.5% (15, 30, 60 mg/kg).
Decreased the mortality rate from 95% to 65%, 60% and 45% (1.25, 2.5 and 5 mg/kg).
Decreased the circulatory LPS and TNF-a levels in a time-dependent manner.
|
|
| | KukoaMine B Preparation Products And Raw materials |
|