|
|
| | Boc-D-4-iodophenylalanine Basic information |
| | Boc-D-4-iodophenylalanine Chemical Properties |
| Boiling point | 475.3±40.0 °C(Predicted) | | density | 1.560±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) | | pka | 3.84±0.10(Predicted) | | form | Powder | | color | White | | Sensitive | Light Sensitive | | BRN | 7518620 | | Major Application | peptide synthesis | | InChI | 1S/C14H18INO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-4-6-10(15)7-5-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m1/s1 | | InChIKey | JZLZDBGQWRBTHN-LLVKDONJSA-N | | SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(I)cc1)C(O)=O | | CAS DataBase Reference | 176199-35-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | WGK Germany | 3 | | F | 8 | | HazardClass | IRRITANT | | HS Code | 2922498590 | | Storage Class | 11 - Combustible Solids |
| | Boc-D-4-iodophenylalanine Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | Boc-D-4-iodophenylalanine Preparation Products And Raw materials |
|