|
|
| | BOC-PHE(3-I)-OH Basic information |
| Product Name: | BOC-PHE(3-I)-OH | | Synonyms: | N-ALPHA-TERT-BUTYLOXYCARBONYL-3-IODO-L-PHENYLALANINE;N-ALPHA-BUTOXYCARBONYL-3-IODO-L-PHENYLALANINE;(S)-BOC-3-IODOPHENYLALANINE;BOC-PHE(3-I)-OH;BOC-3-IODO-L-PHENYLALANINE;BOC-L-3-IODOPHENYLALANINE;BOC-L-PHE(3-I);BOC-L-PHE(3-I)-OH | | CAS: | 273221-75-3 | | MF: | C14H18INO4 | | MW: | 391.2 | | EINECS: | | | Product Categories: | Amino Acids | | Mol File: | 273221-75-3.mol |  |
| | BOC-PHE(3-I)-OH Chemical Properties |
| Boiling point | 491.6±45.0 °C(Predicted) | | density | 1.560±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 3.82±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H18INO4/c1-14(2,3)20-13(19)16-11(12(17)18)8-9-5-4-6-10(15)7-9/h4-7,11H,8H2,1-3H3,(H,16,19)(H,17,18)/t11-/m0/s1 | | InChIKey | MPTBEGFNTNOLNZ-NSHDSACASA-N | | SMILES | C(O)(=O)[C@H](CC1=CC=CC(I)=C1)NC(OC(C)(C)C)=O |
| HazardClass | IRRITANT | | HS Code | 2922498590 |
| | BOC-PHE(3-I)-OH Usage And Synthesis |
| Uses | N-Boc-L-3-Iodophenylalanine is an intermediate used in teh synthesis of peptidyl nitriles as dipeptidyl peptidase 1 inhibitors. |
| | BOC-PHE(3-I)-OH Preparation Products And Raw materials |
|